Link to this page
Chemical Entities of Biological Interest Ontology
| Preferred Name | dimenhydrinate | |
| Synonyms |
Benzhydryl-beta-dimethylaminoethylether 8-chlorotheophylline dimenhydrinate O-benzhydryldimethylaminoethanol 8-chlorotheophyllinate dimenhydrinatum 8-chloro-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 2-(diphenylmethoxy)-N,N-dimethylethanamine (1:1) beta-dimethylaminoethyl benzhydryl ether 1,3-dimethyl-8-chloroxanthine N,N-dimethyl-2-diphenylmethoxyethylamine 8-chlorotheophyllinate diphenhydramine theoclate (O-benzhydryl(dimethylamino)ethanol) 8-chlorotheophyllinate dimenhidrinato diphenhydramine 8-chlorotheophyllinate diphenhydramine 8-chlorotheophylline 2-(diphenylmethoxy)-N,N-dimethylethanaminium 8-chloro-1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydropurin-7-ide |
|
| Definitions |
The diphenhydramine salt of 8-chlorotheophylline. Its effects are similar to those of diphenhydramine, but it is less potent. It was thought that by combining the antiemetic effects of diphenhydramine with the mild stimulant effects of 8-chlorotheophyline, the extreme drowsiness induced by the former would be mitigated. However, the sedation caused by diphenhydramine is considerably stronger than the stimulation caused by 8-chlorotheophylline. Dimenhydrinate is used mainly as an antiemetic in the prevention and treatment of motion sickness. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4604 |
|
| charge |
0
|
|
| database_cross_reference |
CAS:523-87-5 KEGG:D00520 Patent:US2534813 Patent:US2499058 DrugBank:DB00985
|
|
| definition |
The diphenhydramine salt of 8-chlorotheophylline. Its effects are similar to those of diphenhydramine, but it is less potent. It was thought that by combining the antiemetic effects of diphenhydramine with the mild stimulant effects of 8-chlorotheophyline, the extreme drowsiness induced by the former would be mitigated. However, the sedation caused by diphenhydramine is considerably stronger than the stimulation caused by 8-chlorotheophylline. Dimenhydrinate is used mainly as an antiemetic in the prevention and treatment of motion sickness.
|
|
| formula |
C24H28ClN5O3
|
|
| has part | ||
| has role | ||
| has_exact_synonym |
2-(diphenylmethoxy)-N,N-dimethylethanaminium 8-chloro-1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydropurin-7-ide
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
Benzhydryl-beta-dimethylaminoethylether 8-chlorotheophylline dimenhydrinate O-benzhydryldimethylaminoethanol 8-chlorotheophyllinate dimenhydrinatum 8-chloro-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 2-(diphenylmethoxy)-N,N-dimethylethanamine (1:1) beta-dimethylaminoethyl benzhydryl ether 1,3-dimethyl-8-chloroxanthine N,N-dimethyl-2-diphenylmethoxyethylamine 8-chlorotheophyllinate diphenhydramine theoclate (O-benzhydryl(dimethylamino)ethanol) 8-chlorotheophyllinate dimenhidrinato diphenhydramine 8-chlorotheophyllinate diphenhydramine 8-chlorotheophylline
|
|
| id |
CHEBI:4604
|
|
| in_subset | ||
| inchi |
InChI=1S/C17H21NO.C7H7ClN4O2/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h3-12,17H,13-14H2,1-2H3;1-2H3,(H,9,10,13)
|
|
| inchikey |
DKHVTDUUNTVKOW-UHFFFAOYSA-N
|
|
| label |
dimenhydrinate
|
|
| mass |
469.96400
|
|
| monoisotopicmass |
469.18807
|
|
| notation |
CHEBI:4604
|
|
| prefLabel |
dimenhydrinate
|
|
| smiles |
Cn1c2nc(Cl)[n-]c2c(=O)n(C)c1=O.C[NH+](C)CCOC(c1ccccc1)c1ccccc1
|
|
| treeView | ||
| subClassOf |
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |