loading...| Preferred Name |
benzothiazole |
|
| Synonyms |
1,3-benzothiazole BENZOTHIAZOLE Benzothiazol BT Benzosulfonazole 1-Thia-3-azaindene |
|
| Definitions |
An organic heterobicyclic compound that is a fusion product between benzene and thiazole. The parent of the class of benzothiazoles. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_45993 |
|
| charge |
0 |
|
| database_cross_reference |
UM-BBD_compID:c1128 PMID:24248888 HMDB:HMDB0032930 PDBeChem:THZ Reaxys:109468 PMID:15750776 DrugBank:DB08624 CAS:95-16-9 Beilstein:109468 PMID:18568896 PMID:23500410 Wikipedia:Benzothiazole |
|
| definition |
An organic heterobicyclic compound that is a fusion product between benzene and thiazole. The parent of the class of benzothiazoles. |
|
| formula |
C7H5NS |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
| has_exact_synonym |
1,3-benzothiazole BENZOTHIAZOLE |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Benzothiazol BT Benzosulfonazole 1-Thia-3-azaindene |
|
| id |
CHEBI:45993 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H5NS/c1-2-4-7-6(3-1)8-5-9-7/h1-5H |
|
| inchikey |
IOJUPLGTWVMSFF-UHFFFAOYSA-N |
|
| label |
benzothiazole |
|
| mass |
135.18734 |
|
| monoisotopicmass |
135.01427 |
|
| notation |
CHEBI:45993 |
|
| prefLabel |
benzothiazole |
|
| smiles |
c1ccc2scnc2c1 |
|
| treeView | ||
| subClassOf |