loading...| Preferred Name | dicyclomine | |
| Synonyms |
2-(diethylamino)ethyl 1-cyclohexylcyclohexanecarboxylate Dicycloverin dicycloverine Bicyclohexyl-1-carboxylic acid 2-diethylamino-ethyl ester dicicloverina dicycloverinum Dicyclomine DICYCLOMINE 2-(diethylamino)ethyl 1,1'-bi(cyclohexyl)-1-carboxylate |
|
| Definitions |
The ester resulting from the formal condensation of 1-cyclohexylcyclohexanecarboxylic acid with 2-(diethylamino)ethanol. An anticholinergic, it is used as the hydrochloride to treat or prevent spasm in the muscles of the gastrointestinal tract, particularly that associated with irritable bowel syndrome. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4514 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C06951 CAS:77-19-0 DrugBank:DB00804 Beilstein:2282819 Wikipedia:Dicyclomine KEGG:D07820 LINCS:LSM-3534 Drug_Central:868 Patent:US2474796 |
|
| definition |
The ester resulting from the formal condensation of 1-cyclohexylcyclohexanecarboxylic acid with 2-(diethylamino)ethanol. An anticholinergic, it is used as the hydrochloride to treat or prevent spasm in the muscles of the gastrointestinal tract, particularly that associated with irritable bowel syndrome. |
|
| formula |
C19H35NO2 |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_53784 |
|
| has_alternative_id |
CHEBI:265774 |
|
| has_exact_synonym |
Dicyclomine DICYCLOMINE 2-(diethylamino)ethyl 1,1'-bi(cyclohexyl)-1-carboxylate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-(diethylamino)ethyl 1-cyclohexylcyclohexanecarboxylate Dicycloverin dicycloverine Bicyclohexyl-1-carboxylic acid 2-diethylamino-ethyl ester dicicloverina dicycloverinum |
|
| id |
CHEBI:4514 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H35NO2/c1-3-20(4-2)15-16-22-18(21)19(13-9-6-10-14-19)17-11-7-5-8-12-17/h17H,3-16H2,1-2H3 |
|
| inchikey |
CURUTKGFNZGFSE-UHFFFAOYSA-N |
|
| label |
dicyclomine |
|
| mass |
309.48670 |
|
| monoisotopicmass |
309.26678 |
|
| notation |
CHEBI:4514 |
|
| prefLabel |
dicyclomine |
|
| smiles |
CCN(CC)CCOC(=O)C1(CCCCC1)C1CCCCC1 |
|
| treeView | ||
| subClassOf |