loading...| Preferred Name | metyrapone | |
| Synonyms |
Metopiron metyraponum metirapona Metopirone metyrapone Metyrapone 2-methyl-1,2-dipyridin-3-ylpropan-1-one METYRAPONE |
|
| Definitions |
An aromatic ketone that is 3,3-dimethylbutan-2-one in which the methyl groups at positions 1 and 4 are replaced by pyridin-3-yl groups. A steroid 11beta-monooxygenase (EC 1.14.15.4) inhibitor, it is used in the diagnosis of adrenal insufficiency. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_44241 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:54-36-4 Patent:US2966493 DrugBank:DB01011 LINCS:LSM-3035 Beilstein:163023 Drug_Central:1791 PDBeChem:MYT Wikipedia:Metyrapone KEGG:C07205 KEGG:D00410 Reaxys:163023 |
|
| definition |
An aromatic ketone that is 3,3-dimethylbutan-2-one in which the methyl groups at positions 1 and 4 are replaced by pyridin-3-yl groups. A steroid 11beta-monooxygenase (EC 1.14.15.4) inhibitor, it is used in the diagnosis of adrenal insufficiency. |
|
| formula |
C14H14N2O |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_33295 |
|
| has_alternative_id |
CHEBI:44238 CHEBI:6911 |
|
| has_exact_synonym |
Metyrapone 2-methyl-1,2-dipyridin-3-ylpropan-1-one METYRAPONE |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Metopiron metyraponum metirapona Metopirone metyrapone |
|
| id |
CHEBI:44241 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H14N2O/c1-14(2,12-6-4-8-16-10-12)13(17)11-5-3-7-15-9-11/h3-10H,1-2H3 |
|
| inchikey |
FJLBFSROUSIWMA-UHFFFAOYSA-N |
|
| label |
metyrapone |
|
| mass |
226.27380 |
|
| monoisotopicmass |
226.11061 |
|
| notation |
CHEBI:44241 |
|
| prefLabel |
metyrapone |
|
| smiles |
CC(C)(C(=O)c1cccnc1)c1cccnc1 |
|
| treeView | ||
| subClassOf |