loading...| Preferred Name |
(S)-fenfluramine |
|
| Synonyms |
(S)-fenfluramine (2S)-N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine dexfenfluramine (S)-N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine dextrofenfluramine (+)-fenfluramine dexfenfluramina d-N-ethyl-alpha-methyl-m-trifluoromethylphenethylamine dexfenfluraminum |
|
| Definitions |
The S-enantiomer of fenfluramine. It stimulates the release of serotonin and selectively inhibits its reuptake, but unlike fenfluramine it does not possess catecholamine agonist activity. It was formerly given by mouth as the hydrochloride in the treatment of obesity, but, like fenfluramine, was withdrawn wolrdwide following reports of valvular heart defects. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_439329 |
|
| charge |
0 |
|
| database_cross_reference |
LINCS:LSM-5685 DrugBank:DB01191 Drug_Central:832 CAS:3239-44-9 Patent:US3198834 Beilstein:4783710 PMID:16257207 KEGG:D07805 |
|
| definition |
The S-enantiomer of fenfluramine. It stimulates the release of serotonin and selectively inhibits its reuptake, but unlike fenfluramine it does not possess catecholamine agonist activity. It was formerly given by mouth as the hydrochloride in the treatment of obesity, but, like fenfluramine, was withdrawn wolrdwide following reports of valvular heart defects. |
|
| formula |
C12H16F3N |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_50949 |
|
| has_exact_synonym |
(S)-fenfluramine (2S)-N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
dexfenfluramine (S)-N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine dextrofenfluramine (+)-fenfluramine dexfenfluramina d-N-ethyl-alpha-methyl-m-trifluoromethylphenethylamine dexfenfluraminum |
|
| id |
CHEBI:439329 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H16F3N/c1-3-16-9(2)7-10-5-4-6-11(8-10)12(13,14)15/h4-6,8-9,16H,3,7H2,1-2H3/t9-/m0/s1 |
|
| inchikey |
DBGIVFWFUFKIQN-VIFPVBQESA-N |
|
| is enantiomer of | ||
| label |
(S)-fenfluramine |
|
| mass |
231.25730 |
|
| monoisotopicmass |
231.12348 |
|
| notation |
CHEBI:439329 |
|
| prefLabel |
(S)-fenfluramine |
|
| smiles |
CCN[C@@H](C)Cc1cccc(c1)C(F)(F)F |
|
| treeView | ||
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_439329 | PDRO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_439329 | DINTO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_439329 | BERO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_439329 | BIOMODELS | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_439329 | DRON | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_439329 | PDRO | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_439329 | DINTO | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_439329 | BERO | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_439329 | BIOMODELS | LOOM |