Preferred Name | obeticholic acid | |
Synonyms |
6-ECDCA 6alpha-ethylchenodeoxycholic acid Ocaliva INT 747 INT-747 (3alpha,5beta,6alpha,7alpha)-6-ethyl-3,7-dihydroxycholan-24-oic acid obeticholic acid 6alpha-Ethyl-chenodeoxycholic acid INT747 6-Ethylchenodeoxycholic acid 6-Ethyl-CDCA 6alpha-ethyl-3alpha,7alpha-dihydroxy-5beta-cholan-24-oic acid |
|
Definitions |
A dihydroxy-5beta-cholanic acid that is chenodeoxycholic acid carrying an additional ethyl substituent at the 6alpha-position. A semi-synthetic bile acid which acts as a farnesoid X receptor agonist and is used for treatment of primary biliary cholangitis. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_43602 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D09360 PMID:23593273 PMID:25329562 PMID:27109453 PMID:26723896 Drug_Central:5155 PMID:25500425 PMID:27468093 PDBeChem:CHC PMID:27406083 PMID:26169862 PMID:26811456 Reaxys:9238543 PMID:25726736 PMID:27475255 KEGG:C15636 PMID:26812075 PMID:26549695 PMID:25864227 PMID:24382005 PMID:26169860 PMID:25592258 PMID:26136168 CAS:459789-99-2 PMID:27425465 PMID:26169861 PMID:25468160 PMID:25421586 PMID:24623154 PMID:22406511 Wikipedia:Obeticholic_acid PMID:25753820 |
|
definition |
A dihydroxy-5beta-cholanic acid that is chenodeoxycholic acid carrying an additional ethyl substituent at the 6alpha-position. A semi-synthetic bile acid which acts as a farnesoid X receptor agonist and is used for treatment of primary biliary cholangitis. |
|
formula |
C26H44O4 |
|
has functional parent | ||
has role | ||
has_alternative_id |
CHEBI:41467 CHEBI:132971 CHEBI:43599 |
|
has_exact_synonym |
6alpha-ethyl-3alpha,7alpha-dihydroxy-5beta-cholan-24-oic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
6-ECDCA 6alpha-ethylchenodeoxycholic acid Ocaliva INT 747 INT-747 (3alpha,5beta,6alpha,7alpha)-6-ethyl-3,7-dihydroxycholan-24-oic acid obeticholic acid 6alpha-Ethyl-chenodeoxycholic acid INT747 6-Ethylchenodeoxycholic acid 6-Ethyl-CDCA |
|
id |
CHEBI:43602 |
|
in_subset | ||
inchi |
InChI=1S/C26H44O4/c1-5-17-21-14-16(27)10-12-26(21,4)20-11-13-25(3)18(15(2)6-9-22(28)29)7-8-19(25)23(20)24(17)30/h15-21,23-24,27,30H,5-14H2,1-4H3,(H,28,29)/t15-,16-,17-,18-,19+,20+,21+,23+,24-,25-,26-/m1/s1 |
|
inchikey |
ZXERDUOLZKYMJM-ZWECCWDJSA-N |
|
label |
obeticholic acid |
|
mass |
420.626 |
|
monoisotopicmass |
420.32396 |
|
notation |
CHEBI:43602 |
|
prefLabel |
obeticholic acid |
|
smiles |
C1[C@@]2([C@]3(CC[C@]4([C@]([C@@]3([C@@H]([C@@H]([C@@]2(C[C@@H](C1)O)[H])CC)O)[H])(CC[C@@]4([C@@H](CCC(O)=O)C)[H])[H])C)[H])C |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_36843 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36843 |