loading...| Preferred Name |
galanthamine |
|
| Synonyms |
Galanthamine galanthamine galantamine galanthaminum (-)-galanthamine galantamina (-)-galantamine (4aS,6R,8aS)-3-methoxy-11-methyl-5,6,9,10,11,12-hexahydro-4aH-[1]benzofuro[3a,3,2-ef][2]benzazepin-6-ol |
|
| Definitions |
A benzazepine alkaloid isolated from certain species of daffodils. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_42944 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:11119642 PMID:11950787 PMID:19782102 PDBeChem:GNT Beilstein:93736 CAS:357-70-0 PMID:15537482 KEGG:C08526 HMDB:HMDB0014812 Chemspider:9272 Drug_Central:1272 Reaxys:93736 PMID:17481657 PMID:10606746 PMID:14674789 PMID:11060814 PMID:15563167 KNApSAcK:C00001570 MetaCyc:CPD-19430 KEGG:D04292 PMID:23035744 LINCS:LSM-5604 Wikipedia:Galantamine PMID:19253410 PMID:12177686 DrugBank:DB00674 PMID:15495017 PMID:5333582 PMID:16437436 |
|
| definition |
A benzazepine alkaloid isolated from certain species of daffodils. |
|
| formula |
C17H21NO3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_38323 http://purl.obolibrary.org/obo/CHEBI_37733 |
|
| has_alternative_id |
CHEBI:5264 CHEBI:42935 |
|
| has_exact_synonym |
Galanthamine galanthamine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
galantamine galanthaminum (-)-galanthamine galantamina (-)-galantamine (4aS,6R,8aS)-3-methoxy-11-methyl-5,6,9,10,11,12-hexahydro-4aH-[1]benzofuro[3a,3,2-ef][2]benzazepin-6-ol |
|
| id |
CHEBI:42944 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H21NO3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17/h3-6,12,14,19H,7-10H2,1-2H3/t12-,14-,17-/m0/s1 |
|
| inchikey |
ASUTZQLVASHGKV-JDFRZJQESA-N |
|
| is conjugate base of | ||
| label |
galanthamine |
|
| mass |
287.35358 |
|
| monoisotopicmass |
287.15214 |
|
| notation |
CHEBI:42944 |
|
| prefLabel |
galanthamine |
|
| smiles |
[H][C@]12C[C@@H](O)C=C[C@]11CCN(C)Cc3ccc(OC)c(O2)c13 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_38523 http://purl.obolibrary.org/obo/CHEBI_38527 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38523 http://purl.obolibrary.org/obo/CHEBI_38527 |