loading...| Preferred Name | cathine | |
| Synonyms |
(1S,2S)-norpseudoephedrine (+)-norpseudoephedrine (+)-pseudonorephedrine D-norpseudoephedrine d-norpseudoephedrine D-(+)-norpseudoephedrine D-cathine (+)-cathine (1S,2S)-(+)-norpseudoephedrine (1S,2S)-2-amino-1-phenyl-1-propanol katine (1S,2S)-2-amino-1-phenylpropan-1-ol |
|
| Definitions |
An amphetamine that is propylbenzene substituted by a hydroxy group at position 1 and by an amino group at position 2 (the 1S,2S-stereoisomer). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4109 |
|
| charge |
0 |
|
| database_cross_reference |
Chemspider:390189 PMID:33551812 KEGG:C08300 PMID:17158213 Reaxys:2802895 DrugBank:DB01486 PMID:3172133 PMID:23960776 PMID:34821129 PMID:34464621 PMID:33370655 KNApSAcK:C00001405 PMID:32589765 PMID:28873376 PMID:34040530 Wikipedia:Cathine PMID:3621583 PMID:33414048 PMID:25013783 PMID:15513978 KEGG:D07627 PMID:6644577 PMID:3662492 PMID:30148450 CAS:492-39-7 PMID:33177980 Drug_Central:3389 |
|
| definition |
An amphetamine that is propylbenzene substituted by a hydroxy group at position 1 and by an amino group at position 2 (the 1S,2S-stereoisomer). |
|
| formula |
C9H13NO |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35337 |
|
| has_exact_synonym |
(1S,2S)-2-amino-1-phenylpropan-1-ol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(1S,2S)-norpseudoephedrine (+)-norpseudoephedrine (+)-pseudonorephedrine D-norpseudoephedrine d-norpseudoephedrine D-(+)-norpseudoephedrine D-cathine (+)-cathine (1S,2S)-(+)-norpseudoephedrine (1S,2S)-2-amino-1-phenyl-1-propanol katine |
|
| id |
CHEBI:4109 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9+/m0/s1 |
|
| inchikey |
DLNKOYKMWOXYQA-IONNQARKSA-N |
|
| label |
cathine |
|
| mass |
151.209 |
|
| monoisotopicmass |
151.09971 |
|
| notation |
CHEBI:4109 |
|
| prefLabel |
cathine |
|
| smiles |
C[C@H](N)[C@@H](O)C1=CC=CC=C1 |
|
| treeView | ||
| subClassOf |