loading...| Preferred Name |
perflubron |
|
| Synonyms |
1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane perfluorooctyl bromide LiquiVent CF3-(CF2)6-CF2-Br 1-bromoheptadecafluorooctane Imagent GI bromure de n-perfluorooctyle 1-bromoperfluorooctane PFOB perfluoro-octylbromide |
|
| Definitions |
A haloalkane that is perfluorooctane in which a fluorine attached to one of the terminal carbons has been replaced by a bromine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_38803 |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:2102 CAS:423-55-2 Gmelin:613053 Patent:US5928663 Patent:US3975512 Patent:EP0549387 Beilstein:2016022 Patent:WO2006059063 Patent:RU2162692 Patent:WO2007105978 Patent:CA2156922 Patent:WO2007139827 Patent:GB1381879 Patent:WO0234297 Patent:WO9103267 |
|
| definition |
A haloalkane that is perfluorooctane in which a fluorine attached to one of the terminal carbons has been replaced by a bromine. |
|
| formula |
C8BrF17 |
|
| has parent hydride | ||
| has role | ||
| has_exact_synonym |
1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
perfluorooctyl bromide LiquiVent CF3-(CF2)6-CF2-Br 1-bromoheptadecafluorooctane Imagent GI bromure de n-perfluorooctyle 1-bromoperfluorooctane PFOB perfluoro-octylbromide |
|
| id |
CHEBI:38803 |
|
| in_subset | ||
| inchi |
InChI=1S/C8BrF17/c9-7(22,23)5(18,19)3(14,15)1(10,11)2(12,13)4(16,17)6(20,21)8(24,25)26 |
|
| inchikey |
WTWWXOGTJWMJHI-UHFFFAOYSA-N |
|
| label |
perflubron |
|
| mass |
498.962 |
|
| monoisotopicmass |
497.89119 |
|
| notation |
CHEBI:38803 |
|
| prefLabel |
perflubron |
|
| smiles |
FC(C(C(C(C(C(C(C(Br)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_24469 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_24469 |