loading...| Preferred Name |
carvone |
|
| Synonyms |
carvone p-mentha-1(6),8-dien-2-one 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-enone carvol 1-carvone 5-isopropenyl-2-methylcyclohex-2-en-1-one Karvon 2-methyl-5-(1-methylethenyl)-2-cyclohexen-1-one p-mentha-6,8-dien-2-one 2-methyl-5-isopropenyl-2-cyclohexenone 2-methyl-5-(1-methyl-1-ethenyl)-2-cyclohexen-1-one Carvon |
|
| Definitions |
A p-menthane monoterpenoid that consists of cyclohex-2-enone having methyl and isopropenyl substituents at positions 2 and 5, respectively. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_38265 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:20233552 PMID:16638680 Gmelin:102300 PMID:19876560 CAS:99-49-0 Reaxys:1364206 Beilstein:1364206 PMID:21428701 MetaCyc:Carvones Wikipedia:Carvone |
|
| definition |
A p-menthane monoterpenoid that consists of cyclohex-2-enone having methyl and isopropenyl substituents at positions 2 and 5, respectively. |
|
| formula |
C10H14O |
|
| has role | ||
| has_exact_synonym |
carvone p-mentha-1(6),8-dien-2-one 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-methyl-5-(prop-1-en-2-yl)cyclohex-2-enone carvol 1-carvone 5-isopropenyl-2-methylcyclohex-2-en-1-one Karvon 2-methyl-5-(1-methylethenyl)-2-cyclohexen-1-one p-mentha-6,8-dien-2-one 2-methyl-5-isopropenyl-2-cyclohexenone 2-methyl-5-(1-methyl-1-ethenyl)-2-cyclohexen-1-one Carvon |
|
| id |
CHEBI:38265 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3 |
|
| inchikey |
ULDHMXUKGWMISQ-UHFFFAOYSA-N |
|
| label |
carvone |
|
| mass |
150.21756 |
|
| monoisotopicmass |
150.10447 |
|
| notation |
CHEBI:38265 |
|
| prefLabel |
carvone |
|
| smiles |
CC(=C)C1CC=C(C)C(=O)C1 |
|
| treeView | ||
| subClassOf |