loading...| Preferred Name | quinazoline | |
| Synonyms |
1,3-benzodiazine benzo[a]pyrimidine 1,3-diazanaphthalene Chinazolin phenmiazine 5,6-benzopyrimidine quinazoline |
|
| Definitions |
A mancude organic heterobicyclic parent that is naphthalene in which the carbon atoms at positions 1 and 3 have been replaced by nitrogen atoms. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_36621 |
|
| charge |
0 |
|
| database_cross_reference |
Gmelin:663230 Beilstein:109370 CAS:253-82-7 |
|
| definition |
A mancude organic heterobicyclic parent that is naphthalene in which the carbon atoms at positions 1 and 3 have been replaced by nitrogen atoms. |
|
| formula |
C8H6N2 |
|
| has_exact_synonym |
quinazoline |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1,3-benzodiazine benzo[a]pyrimidine 1,3-diazanaphthalene Chinazolin phenmiazine 5,6-benzopyrimidine |
|
| id |
CHEBI:36621 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H6N2/c1-2-4-8-7(3-1)5-9-6-10-8/h1-6H |
|
| inchikey |
JWVCLYRUEFBMGU-UHFFFAOYSA-N |
|
| label |
quinazoline |
|
| mass |
130.14672 |
|
| monoisotopicmass |
130.05310 |
|
| notation |
CHEBI:36621 |
|
| prefLabel |
quinazoline |
|
| smiles |
c1ccc2ncncc2c1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_38530 http://purl.obolibrary.org/obo/CHEBI_50893 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38530 http://purl.obolibrary.org/obo/CHEBI_50893 |