loading...| Preferred Name | cephalexin | |
| Synonyms |
Ceporexin Celexin 7-(D-alpha-Aminophenylacetamido)desacetoxycephalosporanic acid cefalexine Cefalexin cefalexinum (6R,7R)-7-{[(2R)-2-amino-2-phenylacetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid cefalexina CEX Cepastar Cephacillin Cepexin 7-beta-(D-alpha-Amino-alpha-phenylacetylamino)-3-methyl-3-cephem-4-carboxylic acid 7beta-[(2R)-2-amino-2-phenylacetamido]-3-methyl-3,4-didehydrocepham-4-carboxylic acid |
|
| Definitions |
A semisynthetic first-generation cephalosporin antibiotic having methyl and beta-(2R)-2-amino-2-phenylacetamido groups at the 3- and 7- of the cephem skeleton, respectively. It is effective against both Gram-negative and Gram-positive organisms, and is used for treatment of infections of the skin, respiratory tract and urinary tract. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3534 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22559990 PMID:23061564 CAS:15686-71-2 HMDB:HMDB0014707 PMID:12833570 Patent:US3507861 DrugBank:DB00567 PMID:23545436 KEGG:D00263 Wikipedia:Cefalexin LINCS:LSM-5957 PMID:1384868 PMID:23811740 KEGG:C06895 Reaxys:4238892 PMID:10930630 PMID:23688276 PMID:24268227 PMID:2083978 PMID:12569987 Patent:US3275626 PMID:29017833 PMID:24548092 Drug_Central:571 PMID:23457080 VSDB:1791 Beilstein:965503 |
|
| definition |
A semisynthetic first-generation cephalosporin antibiotic having methyl and beta-(2R)-2-amino-2-phenylacetamido groups at the 3- and 7- of the cephem skeleton, respectively. It is effective against both Gram-negative and Gram-positive organisms, and is used for treatment of infections of the skin, respiratory tract and urinary tract. |
|
| formula |
C16H17N3O4S |
|
| has role | ||
| has_exact_synonym |
7beta-[(2R)-2-amino-2-phenylacetamido]-3-methyl-3,4-didehydrocepham-4-carboxylic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Ceporexin Celexin 7-(D-alpha-Aminophenylacetamido)desacetoxycephalosporanic acid cefalexine Cefalexin cefalexinum (6R,7R)-7-{[(2R)-2-amino-2-phenylacetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid cefalexina CEX Cepastar Cephacillin Cepexin 7-beta-(D-alpha-Amino-alpha-phenylacetylamino)-3-methyl-3-cephem-4-carboxylic acid |
|
| id |
CHEBI:3534 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H17N3O4S/c1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9/h2-6,10-11,15H,7,17H2,1H3,(H,18,20)(H,22,23)/t10-,11-,15-/m1/s1 |
|
| inchikey |
ZAIPMKNFIOOWCQ-UEKVPHQBSA-N |
|
| is conjugate acid of | ||
| label |
cephalexin |
|
| mass |
347.38900 |
|
| monoisotopicmass |
347.09398 |
|
| notation |
CHEBI:3534 |
|
| prefLabel |
cephalexin |
|
| smiles |
[H][C@]12SCC(C)=C(N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1)C(O)=O |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_23066 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_23066 |