Jump to:
loading...| Preferred Name |
1,2,3-trichlorobenzene |
|
| Synonyms |
1,2,3-Trichlorbenzol vic-trichlorobenzene 1,2,6-trichlorobenzene 1,2,3-Trichlorobenzene 1,2,3-trichlorobenzene |
|
| Definitions |
A trichlorobenzene carrying chloro substituents at positions 1, 2 and 3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_35289 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C14408 PMID:24289932 Beilstein:956882 Gmelin:847785 MetaCyc:CPD-10627 CAS:87-61-6 Reaxys:956882 UM-BBD_compID:c0687 |
|
| definition |
A trichlorobenzene carrying chloro substituents at positions 1, 2 and 3. |
|
| formula |
C6H3Cl3 |
|
| has_alternative_id |
CHEBI:34035 CHEBI:18860 |
|
| has_exact_synonym |
1,2,3-Trichlorobenzene 1,2,3-trichlorobenzene |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1,2,3-Trichlorbenzol vic-trichlorobenzene 1,2,6-trichlorobenzene |
|
| id |
CHEBI:35289 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H3Cl3/c7-4-2-1-3-5(8)6(4)9/h1-3H |
|
| inchikey |
RELMFMZEBKVZJC-UHFFFAOYSA-N |
|
| label |
1,2,3-trichlorobenzene |
|
| mass |
181.44612 |
|
| monoisotopicmass |
179.93003 |
|
| notation |
CHEBI:35289 |
|
| prefLabel |
1,2,3-trichlorobenzene |
|
| smiles |
Clc1cccc(Cl)c1Cl |
|
| treeView | ||
| subClassOf |
Create mapping