loading...| Preferred Name |
cefmetazole sodium |
|
| Synonyms |
sodium 6beta-{[(cyanomethyl)sulfanyl]acetamido}-6alpha-methoxy-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}ceph-3-em-4-carboxylate Cefmetazole sodium Zefazone CS 1170 sodium cefmetazone CMZ SKF 83088 sodium Cefmetazon CMZ sodium |
|
| Definitions |
An organic sodium salt that is the sodium salt of cefmetazole. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3490 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:17939016 KEGG:D00911 Reaxys:5403925 KEGG:C08104 Beilstein:5403925 CAS:56796-39-5 PMID:6176550 |
|
| definition |
An organic sodium salt that is the sodium salt of cefmetazole. |
|
| formula |
C15H16N7O5S3.Na C15H16N7NaO5S3 |
|
| has part | ||
| has role | ||
| has_exact_synonym |
sodium 6beta-{[(cyanomethyl)sulfanyl]acetamido}-6alpha-methoxy-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}ceph-3-em-4-carboxylate Cefmetazole sodium |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Zefazone CS 1170 sodium cefmetazone CMZ SKF 83088 sodium Cefmetazon CMZ sodium |
|
| id |
CHEBI:3490 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H17N7O5S3.Na/c1-21-14(18-19-20-21)30-6-8-5-29-13-15(27-2,17-9(23)7-28-4-3-16)12(26)22(13)10(8)11(24)25;/h13H,4-7H2,1-2H3,(H,17,23)(H,24,25);/q;+1/p-1/t13-,15+;/m1./s1 |
|
| inchikey |
BITQGIOJQWZUPL-PBCQUBLHSA-M |
|
| label |
cefmetazole sodium |
|
| mass |
493.51600 |
|
| monoisotopicmass |
493.02727 |
|
| notation |
CHEBI:3490 |
|
| prefLabel |
cefmetazole sodium |
|
| smiles |
[Na+].[H][C@]12SCC(CSc3nnnn3C)=C(N1C(=O)[C@]2(NC(=O)CSCC#N)OC)C([O-])=O |
|
| treeView | ||
| subClassOf |