loading...| Preferred Name |
thiouracil |
|
| Synonyms |
2-thioxo-2,3-dihydropyrimidin-4(1H)-one 2-Mercapto-pyrimidin-4-ol 2-Thioxo-2,3-dihydro-1H-pyrimidin-4-one 4-Hydroxy-2-pyrimidinethiol 2-mercapto-4-pyrimidinol 2-Thio-2,4-(1H,3H)-pyrimidinedione 2-Thiouracil |
|
| Definitions |
A nucleobase analogue that is uracil in which the oxo group at C-2 is replaced by a thioxo group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_348530 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:141-90-2 Drug_Central:2640 Beilstein:112227 Reaxys:112227 PMID:11094150 Wikipedia:Thiouracil PMID:3654008 PMID:23739752 PMID:7120285 PMID:4316226 PMID:23740976 PMID:8978847 KEGG:C19304 PMID:8068712 |
|
| definition |
A nucleobase analogue that is uracil in which the oxo group at C-2 is replaced by a thioxo group. |
|
| formula |
C4H4N2OS |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
2-thioxo-2,3-dihydropyrimidin-4(1H)-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-Mercapto-pyrimidin-4-ol 2-Thioxo-2,3-dihydro-1H-pyrimidin-4-one 4-Hydroxy-2-pyrimidinethiol 2-mercapto-4-pyrimidinol 2-Thio-2,4-(1H,3H)-pyrimidinedione 2-Thiouracil |
|
| id |
CHEBI:348530 |
|
| in_subset | ||
| inchi |
InChI=1S/C4H4N2OS/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) |
|
| inchikey |
ZEMGGZBWXRYJHK-UHFFFAOYSA-N |
|
| label |
thiouracil |
|
| mass |
128.15200 |
|
| monoisotopicmass |
128.00443 |
|
| notation |
CHEBI:348530 |
|
| prefLabel |
thiouracil |
|
| smiles |
O=c1cc[nH]c(=S)[nH]1 |
|
| treeView | ||
| subClassOf |