Preferred Name |
methyl methacrylate |
|
Synonyms |
Methyl methacrylate Methyl alpha-methylacrylate MMA Methylmethacrylate 2-Methyl-2-propenoic acid methyl ester Methyl 2-methylpropenoate Methyl methylacrylate 2-Methylacrylic acid methyl ester Methyl 2-methylacrylate Methyl 2-methyl-2-propenoate Methacrylic acid methyl ester 2-(Methoxycarbonyl)-1-propene Methacrylsaeuremethyl ester Methyl-methacrylat Methacrylate de methyle |
|
Definitions |
An enoate ester having methacrylic acid as the carboxylic acid component and methanol as the alcohol component. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_34840 |
|
charge |
0 |
|
database_cross_reference |
PMID:23584430 PMID:23242048 PMID:10444249 PMID:16020090 PMID:22566411 PMID:23450227 HMDB:HMDB0032385 PMID:11714252 Reaxys:605459 PMID:23342990 PMID:23432523 Wikipedia:Methyl_methacrylate PMID:23583434 Gmelin:2691 PMID:23508285 PMID:23719017 CAS:80-62-6 PMID:9036138 Beilstein:605459 KEGG:C14527 PMID:23306624 |
|
definition |
An enoate ester having methacrylic acid as the carboxylic acid component and methanol as the alcohol component. |
|
formula |
C5H8O2 |
|
has functional parent | ||
has role | ||
has_exact_synonym |
Methyl methacrylate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Methyl alpha-methylacrylate MMA Methylmethacrylate 2-Methyl-2-propenoic acid methyl ester Methyl 2-methylpropenoate Methyl methylacrylate 2-Methylacrylic acid methyl ester Methyl 2-methylacrylate Methyl 2-methyl-2-propenoate Methacrylic acid methyl ester 2-(Methoxycarbonyl)-1-propene Methacrylsaeuremethyl ester Methyl-methacrylat Methacrylate de methyle |
|
id |
CHEBI:34840 |
|
in_subset | ||
inchi |
InChI=1S/C5H8O2/c1-4(2)5(6)7-3/h1H2,2-3H3 |
|
inchikey |
VVQNEPGJFQJSBK-UHFFFAOYSA-N |
|
label |
methyl methacrylate |
|
mass |
100.117 |
|
monoisotopicmass |
100.05243 |
|
notation |
CHEBI:34840 |
|
prefLabel |
methyl methacrylate |
|
smiles |
COC(C(C)=C)=O |
|
treeView | ||
subClassOf |