loading...| Preferred Name | cefaclor | |
| Synonyms |
CCL cefaclorum Cephaclor 3-Chloro-7-D-(2-phenylglycinamido)-3-cephem-4-carboxylic acid Cefaclor anhydrous cefaclor Cefaclor (6R,7R)-7-{[(2R)-2-amino-2-phenylacetyl]amino}-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid 7beta-{[(2R)-2-amino-2-phenylacetyl]amino}-3-chloro-3,4-didehydrocepham-4-carboxylic acid |
|
| Definitions |
A cephalosporin bearing chloro and (R)-2-amino-2-phenylacetamido groups at positions 3 and 7, respectively, of the cephem skeleton. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3478 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D00256 PMID:11963587 LINCS:LSM-5368 PMID:12485718 HMDB:HMDB0014971 PMID:10230635 PMID:15812119 Patent:DE2408698 KEGG:C06877 Drug_Central:525 PMID:18969055 Patent:US3925372 Reaxys:3632473 CAS:53994-73-3 PMID:10930630 DrugBank:DB00833 Wikipedia:Cefaclor PMID:12569987 PMID:29017833 |
|
| definition |
A cephalosporin bearing chloro and (R)-2-amino-2-phenylacetamido groups at positions 3 and 7, respectively, of the cephem skeleton. |
|
| formula |
C15H14ClN3O4S |
|
| has role | ||
| has_alternative_id |
CHEBI:472656 |
|
| has_exact_synonym |
cefaclor Cefaclor (6R,7R)-7-{[(2R)-2-amino-2-phenylacetyl]amino}-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid 7beta-{[(2R)-2-amino-2-phenylacetyl]amino}-3-chloro-3,4-didehydrocepham-4-carboxylic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
CCL cefaclorum Cephaclor 3-Chloro-7-D-(2-phenylglycinamido)-3-cephem-4-carboxylic acid Cefaclor anhydrous |
|
| id |
CHEBI:3478 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H14ClN3O4S/c16-8-6-24-14-10(13(21)19(14)11(8)15(22)23)18-12(20)9(17)7-4-2-1-3-5-7/h1-5,9-10,14H,6,17H2,(H,18,20)(H,22,23)/t9-,10-,14-/m1/s1 |
|
| inchikey |
QYIYFLOTGYLRGG-GPCCPHFNSA-N |
|
| label |
cefaclor |
|
| mass |
367.80700 |
|
| monoisotopicmass |
367.03935 |
|
| notation |
CHEBI:3478 |
|
| prefLabel |
cefaclor |
|
| smiles |
[H][C@]12SCC(Cl)=C(N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1)C(O)=O |
|
| treeView | ||
| subClassOf |