loading...| Preferred Name |
carmustine |
|
| Synonyms |
Carmustine 1,3-bis(2-chloroethyl)-1-nitrosourea Gliadel BCNU carmustina carmustine Bischloroethyl nitrosourea carmustinum Bicnu (TN) N,N'-Bis(2-chloroethyl)-N-nitrosourea |
|
| Definitions |
A member of the class of N-nitrosoureas that is 1,3-bis(2-chloroethyl)urea in which one of the nitrogens is substituted by a nitroso group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3423 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB00262 KEGG:D00254 Drug_Central:512 CAS:154-93-8 Wikipedia:Carmustine |
|
| definition |
A member of the class of N-nitrosoureas that is 1,3-bis(2-chloroethyl)urea in which one of the nitrogens is substituted by a nitroso group. |
|
| formula |
C5H9Cl2N3O2 |
|
| has role | ||
| has_exact_synonym |
Carmustine 1,3-bis(2-chloroethyl)-1-nitrosourea |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Gliadel BCNU carmustina carmustine Bischloroethyl nitrosourea carmustinum Bicnu (TN) N,N'-Bis(2-chloroethyl)-N-nitrosourea |
|
| id |
CHEBI:3423 |
|
| in_subset | ||
| inchi |
InChI=1S/C5H9Cl2N3O2/c6-1-3-8-5(11)10(9-12)4-2-7/h1-4H2,(H,8,11) |
|
| inchikey |
DLGOEMSEDOSKAD-UHFFFAOYSA-N |
|
| label |
carmustine |
|
| mass |
214.05000 |
|
| monoisotopicmass |
213.00718 |
|
| notation |
CHEBI:3423 |
|
| prefLabel |
carmustine |
|
| smiles |
ClCCNC(=O)N(CCCl)N=O |
|
| treeView | ||
| subClassOf |