Preferred Name |
nicotinate |
|
Synonyms |
nicotinate pyridine-3-carboxylate 3-pyridinecarboxylate |
|
Definitions |
A pyridinemonocarboxylate that is the conjugate base of nicotinic acid, arising from deprotonation of the carboxy group; major species at pH 7.3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_32544 |
|
charge |
-1 |
|
database_cross_reference |
MetaCyc:NIACINE Beilstein:3539722 Reaxys:3539722 Gmelin:327384 KEGG:C00253 PMID:21953179 PMID:21742010 PMID:17190852 |
|
definition |
A pyridinemonocarboxylate that is the conjugate base of nicotinic acid, arising from deprotonation of the carboxy group; major species at pH 7.3. |
|
formula |
C6H4NO2 |
|
has role | ||
has_alternative_id |
CHEBI:25530 CHEBI:22851 CHEBI:14650 |
|
has_exact_synonym |
nicotinate pyridine-3-carboxylate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
3-pyridinecarboxylate |
|
id |
CHEBI:32544 |
|
in_subset | ||
inchi |
InChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9)/p-1 |
|
inchikey |
PVNIIMVLHYAWGP-UHFFFAOYSA-M |
|
is conjugate base of | ||
label |
nicotinate |
|
mass |
122.10150 |
|
monoisotopicmass |
122.02475 |
|
notation |
CHEBI:32544 |
|
prefLabel |
nicotinate |
|
smiles |
[O-]C(=O)c1cccnc1 |
|
treeView | ||
subClassOf |