Preferred Name | amineptine | |
Synonyms |
amineptinum Survector Amineptin amineptine amineptino 7-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylamino)heptanoic acid |
|
Definitions |
A carbocyclic fatty acid that is 5-aminoheptanoic acid in which one of the hydrogens attached to the nitrogen is replaced by a 10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl group. A tricyclic antidepressant, it was never approved in the US and was withdrawn from the French market in 1999 due to concerns over abuse, dependence and severe acne. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_32499 |
|
charge |
0 |
|
database_cross_reference |
PMID:2141246 Patent:US3758528 Patent:DE2011806 Drug_Central:161 KEGG:D07335 PMID:9347390 PMID:2131927 PMID:2698268 DrugBank:DB04836 CAS:57574-09-1 PMID:7609861 Beilstein:2170218 Reaxys:2170218 Wikipedia:Amineptine |
|
definition |
A carbocyclic fatty acid that is 5-aminoheptanoic acid in which one of the hydrogens attached to the nitrogen is replaced by a 10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl group. A tricyclic antidepressant, it was never approved in the US and was withdrawn from the French market in 1999 due to concerns over abuse, dependence and severe acne. |
|
formula |
C22H27NO2 |
|
has parent hydride | ||
has role | ||
has_exact_synonym |
7-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylamino)heptanoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
amineptinum Survector Amineptin amineptine amineptino |
|
id |
CHEBI:32499 |
|
in_subset | ||
inchi |
InChI=1S/C22H27NO2/c24-21(25)13-3-1-2-8-16-23-22-19-11-6-4-9-17(19)14-15-18-10-5-7-12-20(18)22/h4-7,9-12,22-23H,1-3,8,13-16H2,(H,24,25) |
|
inchikey |
ONNOFKFOZAJDHT-UHFFFAOYSA-N |
|
label |
amineptine |
|
mass |
337.45530 |
|
monoisotopicmass |
337.20418 |
|
notation |
CHEBI:32499 |
|
prefLabel |
amineptine |
|
smiles |
OC(=O)CCCCCCNC1c2ccccc2CCc2ccccc12 |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_38032 http://purl.obolibrary.org/obo/CHEBI_35744 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38032 http://purl.obolibrary.org/obo/CHEBI_35744 |