Preferred Name |
nicorandil |
|
Synonyms |
2-[(pyridin-3-ylcarbonyl)amino]ethyl nitrate nicorandil SG 75 Ikorel Perisalol N-(2-hydroxyethyl)nicotinamide nitrate Adancor nicorandilum 2-nicotinamidoethyl nitrate SG-75 Sigmart |
|
Definitions |
A pyrimidinecarboxamide that is nicotinamide in which one of the hydrogens attached to the carboxamide nitrogen is replaced by a 2-(nitrooxy)ethyl group. It has both nitrate-like and ATP-sensitive potassium channel activator properties, and is used for the prevention and treatment of angina pectoris. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_31905 |
|
charge |
0 |
|
database_cross_reference |
PMID:24952900 KEGG:D01810 Patent:US4200640 Drug_Central:1919 PMID:23845070 CAS:65141-46-0 PMID:25319832 LINCS:LSM-6009 KEGG:C13280 Patent:DE2714713 PMID:23841868 PMID:24685703 Wikipedia:Nicorandil PMID:24837014 |
|
definition |
A pyrimidinecarboxamide that is nicotinamide in which one of the hydrogens attached to the carboxamide nitrogen is replaced by a 2-(nitrooxy)ethyl group. It has both nitrate-like and ATP-sensitive potassium channel activator properties, and is used for the prevention and treatment of angina pectoris. |
|
formula |
C8H9N3O4 |
|
has functional parent | ||
has role | ||
has_exact_synonym |
2-[(pyridin-3-ylcarbonyl)amino]ethyl nitrate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
nicorandil SG 75 Ikorel Perisalol N-(2-hydroxyethyl)nicotinamide nitrate Adancor nicorandilum 2-nicotinamidoethyl nitrate SG-75 Sigmart |
|
id |
CHEBI:31905 |
|
in_subset | ||
inchi |
InChI=1S/C8H9N3O4/c12-8(7-2-1-3-9-6-7)10-4-5-15-11(13)14/h1-3,6H,4-5H2,(H,10,12) |
|
inchikey |
LBHIOVVIQHSOQN-UHFFFAOYSA-N |
|
label |
nicorandil |
|
mass |
211.17480 |
|
monoisotopicmass |
211.05931 |
|
notation |
CHEBI:31905 |
|
prefLabel |
nicorandil |
|
smiles |
[O-][N+](=O)OCCNC(=O)c1cccnc1 |
|
treeView | ||
subClassOf |