loading...| Preferred Name |
profenamine |
|
| Synonyms |
N,N-diethyl-1-(10H-phenothiazin-10-yl)propan-2-amine 10-[2-(diethylamino)-2-methylethyl]phenothiazine profenamina N,N-diethyl-alpha-methyl-10H-phenothiazine-10-ethanamine 10-[2-(diethylamino)-1-propyl]phenothiazine 2-diethylamino-1-propyl-N-dibenzoparathiazine 10-[2-(diethylamino)propyl]phenothiazine profenamine 10-(2-diethylaminopropyl)phenothiazine N,N-diethyl-1-(10H-phenothiazin-10-yl)-2-propanamine ethopropazine profenaminum |
|
| Definitions |
A member of the class of phenothiazines that is phenothiazine in which the hydrogen attached to the nitrogen is substituted by a 2-(diethylamino)propyl group. An antimuscarinic, it is used as the hydrochloride for the symptomatic treatment of Parkinson's disease. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_313639 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:6539933 Wikipedia:Ethopropazine PMID:17459789 HMDB:HMDB0014536 Reaxys:89828 CAS:522-00-9 KEGG:D08426 Drug_Central:1086 DrugBank:DB00392 Patent:US2607773 LINCS:LSM-1342 |
|
| definition |
A member of the class of phenothiazines that is phenothiazine in which the hydrogen attached to the nitrogen is substituted by a 2-(diethylamino)propyl group. An antimuscarinic, it is used as the hydrochloride for the symptomatic treatment of Parkinson's disease. |
|
| formula |
C19H24N2S |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_37887 http://purl.obolibrary.org/obo/CHEBI_37956 http://purl.obolibrary.org/obo/CHEBI_66956 |
|
| has_exact_synonym |
N,N-diethyl-1-(10H-phenothiazin-10-yl)propan-2-amine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
10-[2-(diethylamino)-2-methylethyl]phenothiazine profenamina N,N-diethyl-alpha-methyl-10H-phenothiazine-10-ethanamine 10-[2-(diethylamino)-1-propyl]phenothiazine 2-diethylamino-1-propyl-N-dibenzoparathiazine 10-[2-(diethylamino)propyl]phenothiazine profenamine 10-(2-diethylaminopropyl)phenothiazine N,N-diethyl-1-(10H-phenothiazin-10-yl)-2-propanamine ethopropazine profenaminum |
|
| id |
CHEBI:313639 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H24N2S/c1-4-20(5-2)15(3)14-21-16-10-6-8-12-18(16)22-19-13-9-7-11-17(19)21/h6-13,15H,4-5,14H2,1-3H3 |
|
| inchikey |
CDOZDBSBBXSXLB-UHFFFAOYSA-N |
|
| label |
profenamine |
|
| mass |
312.47200 |
|
| monoisotopicmass |
312.16602 |
|
| notation |
CHEBI:313639 |
|
| prefLabel |
profenamine |
|
| smiles |
CCN(CC)C(C)CN1c2ccccc2Sc2ccccc12 |
|
| treeView | ||
| subClassOf |