Preferred Name |
calcium glycerophosphate |
|
Synonyms |
Calcium beta-glycerophosphate calcium beta-glycerophosphate 1,2,3-Propanetriol, mono(dihydrogen phosphate), calcium salt beta-glycerophosphoric acid calcium salt 1,2,3-Propanetriol, mono(dihydrogen phosphate) calcium salt Calcium Glycerophosphate calcium 1,3-dihydroxypropan-2-yl phosphate |
|
Definitions |
An organic calcium salt having glycerol 2-phosphate(2-) as the counterion. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_31336 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D01488 KEGG:C12935 Reaxys:3744916 CAS:27214-00-2 |
|
definition |
An organic calcium salt having glycerol 2-phosphate(2-) as the counterion. |
|
formula |
C3H7CaO6P |
|
has part | ||
has_exact_synonym |
Calcium Glycerophosphate calcium 1,3-dihydroxypropan-2-yl phosphate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Calcium beta-glycerophosphate calcium beta-glycerophosphate 1,2,3-Propanetriol, mono(dihydrogen phosphate), calcium salt beta-glycerophosphoric acid calcium salt 1,2,3-Propanetriol, mono(dihydrogen phosphate) calcium salt |
|
id |
CHEBI:31336 |
|
in_subset | ||
inchi |
InChI=1S/C3H9O6P.Ca/c4-1-3(2-5)9-10(6,7)8;/h3-5H,1-2H2,(H2,6,7,8);/q;+2/p-2 |
|
inchikey |
UHHRFSOMMCWGSO-UHFFFAOYSA-L |
|
label |
calcium glycerophosphate |
|
mass |
210.13600 |
|
monoisotopicmass |
209.96062 |
|
notation |
CHEBI:31336 |
|
prefLabel |
calcium glycerophosphate |
|
smiles |
[Ca++].OCC(CO)OP([O-])([O-])=O |
|
treeView | ||
subClassOf |