loading...| Preferred Name |
betaxolol |
|
| Synonyms |
betaxolol 1-(4-(2-(cyclopropylmethoxy)ethyl)phenoxy)-3-((1-methylethyl)amino)-2-propanol 1-(isopropylamino)-3-[p-(cyclopropylmethoxyethyl)phenoxy]-2-propanol betaxololum 1-{4-[2-(cyclopropylmethoxy)ethyl]phenoxy}-3-(propan-2-ylamino)propan-2-ol |
|
| Definitions |
A propanolamine that is 3-aminopropane-1,2-diol in which the hydrogen of the primary hydoxy is substituted by a 4-[2-(cyclopropylmethoxy)ethyl]phenyl group and one of the hydrogens attached to the amino group is substituted by isopropyl. It is a selective beta1-receptor blocker and is used in the treatment of glaucoma as well as hypertension, arrhythmias, and coronary heart disease. It is also used to reduce non-fatal cardiac events in patients with heart failure. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3082 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:10891117 Beilstein:1991268 CAS:63659-18-7 PMID:14971904 LINCS:LSM-1255 KEGG:D07526 PMID:15993593 Patent:DE2649605 Drug_Central:356 PMID:1865331 Reaxys:1991268 Wikipedia:Betaxolol PMID:2569884 PMID:1361581 KEGG:C06849 Patent:US4252984 DrugBank:DB00195 HMDB:HMDB0014341 |
|
| definition |
A propanolamine that is 3-aminopropane-1,2-diol in which the hydrogen of the primary hydoxy is substituted by a 4-[2-(cyclopropylmethoxy)ethyl]phenyl group and one of the hydrogens attached to the amino group is substituted by isopropyl. It is a selective beta1-receptor blocker and is used in the treatment of glaucoma as well as hypertension, arrhythmias, and coronary heart disease. It is also used to reduce non-fatal cardiac events in patients with heart failure. |
|
| formula |
C18H29NO3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_66991 |
|
| has_alternative_id |
CHEBI:101354 |
|
| has_exact_synonym |
1-{4-[2-(cyclopropylmethoxy)ethyl]phenoxy}-3-(propan-2-ylamino)propan-2-ol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
betaxolol 1-(4-(2-(cyclopropylmethoxy)ethyl)phenoxy)-3-((1-methylethyl)amino)-2-propanol 1-(isopropylamino)-3-[p-(cyclopropylmethoxyethyl)phenoxy]-2-propanol betaxololum |
|
| id |
CHEBI:3082 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H29NO3/c1-14(2)19-11-17(20)13-22-18-7-5-15(6-8-18)9-10-21-12-16-3-4-16/h5-8,14,16-17,19-20H,3-4,9-13H2,1-2H3 |
|
| inchikey |
NWIUTZDMDHAVTP-UHFFFAOYSA-N |
|
| label |
betaxolol |
|
| mass |
307.42780 |
|
| monoisotopicmass |
307.21474 |
|
| notation |
CHEBI:3082 |
|
| prefLabel |
betaxolol |
|
| smiles |
CC(C)NCC(O)COc1ccc(CCOCC2CC2)cc1 |
|
| treeView | ||
| subClassOf |