loading...| Preferred Name | benazepril | |
| Synonyms |
benazeprilum 1H-1-Benzazepine-1-acetic acid, 3-((1-(ethoxycarbonyl)-3-phenylpropyl)amino)-2,3,4,5-tetrahydro-2-oxo-, (S-(R*,R*))- benazepril Benazepril [(3S)-3-{[(1S)-1-(ethoxycarbonyl)-3-phenylpropyl]amino}-2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl]acetic acid |
|
| Definitions |
A benzazepine that is benazeprilat in which the carboxy group of the 2-amino-4-phenylbutanoic acid moiety has been converted to the corresponding ethyl ester. It is used (generally as its hydrochloride salt) as a prodrug for the angiotensin-converting enzyme inhibitor benazeprilat in the treatment of hypertension and heart failure. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3011 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:25784709 MetaCyc:CPD-15329 Patent:US4410520 Reaxys:4302258 LINCS:LSM-5609 Patent:EP72352 Drug_Central:299 CAS:86541-75-5 PMID:25224804 PMID:25912588 KEGG:C06843 DrugBank:DB00542 KEGG:D07499 PMID:25738503 Wikipedia:Benazepril HMDB:HMDB0014682 |
|
| definition |
A benzazepine that is benazeprilat in which the carboxy group of the 2-amino-4-phenylbutanoic acid moiety has been converted to the corresponding ethyl ester. It is used (generally as its hydrochloride salt) as a prodrug for the angiotensin-converting enzyme inhibitor benazeprilat in the treatment of hypertension and heart failure. |
|
| formula |
C24H28N2O5 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
Benazepril [(3S)-3-{[(1S)-1-(ethoxycarbonyl)-3-phenylpropyl]amino}-2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl]acetic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
benazeprilum 1H-1-Benzazepine-1-acetic acid, 3-((1-(ethoxycarbonyl)-3-phenylpropyl)amino)-2,3,4,5-tetrahydro-2-oxo-, (S-(R*,R*))- benazepril |
|
| id |
CHEBI:3011 |
|
| in_subset | ||
| inchi |
InChI=1S/C24H28N2O5/c1-2-31-24(30)20(14-12-17-8-4-3-5-9-17)25-19-15-13-18-10-6-7-11-21(18)26(23(19)29)16-22(27)28/h3-11,19-20,25H,2,12-16H2,1H3,(H,27,28)/t19-,20-/m0/s1 |
|
| inchikey |
XPCFTKFZXHTYIP-PMACEKPBSA-N |
|
| is conjugate base of | ||
| label |
benazepril |
|
| mass |
424.48950 |
|
| monoisotopicmass |
424.19982 |
|
| notation |
CHEBI:3011 |
|
| prefLabel |
benazepril |
|
| smiles |
CCOC(=O)[C@H](CCc1ccccc1)N[C@H]1CCc2ccccc2N(CC(O)=O)C1=O |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_35676 http://purl.obolibrary.org/obo/CHEBI_24995 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35676 http://purl.obolibrary.org/obo/CHEBI_24995 |