loading...| Preferred Name |
N-phenylacetamide |
|
| Synonyms |
Acetanilide acetamidobenzene acetanil Acetanilid N-Acetylarylamine N-acetylaminobenzene acetic acid anilide N-phenylacetamide N-Phenylacetamide |
|
| Definitions |
A member of the class of acetamides that is acetamide in which one of the hydrogens attached to the nitrogen is substituted by a phenyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28884 |
|
| charge |
0 |
|
| database_cross_reference |
UM-BBD_compID:c0657 Wikipedia:N-Phenylacetamide KEGG:C07565 CAS:103-84-4 Reaxys:606468 Drug_Central:54 Gmelin:82833 Beilstein:606468 PMID:23862058 |
|
| definition |
A member of the class of acetamides that is acetamide in which one of the hydrogens attached to the nitrogen is substituted by a phenyl group. |
|
| formula |
C8H9NO |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:7331 CHEBI:22164 |
|
| has_exact_synonym |
N-phenylacetamide N-Phenylacetamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Acetanilide acetamidobenzene acetanil Acetanilid N-Acetylarylamine N-acetylaminobenzene acetic acid anilide |
|
| id |
CHEBI:28884 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H9NO/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10) |
|
| inchikey |
FZERHIULMFGESH-UHFFFAOYSA-N |
|
| label |
N-phenylacetamide |
|
| mass |
135.16320 |
|
| monoisotopicmass |
135.06841 |
|
| notation |
CHEBI:28884 |
|
| prefLabel |
N-phenylacetamide |
|
| smiles |
CC(=O)Nc1ccccc1 |
|
| treeView | ||
| subClassOf |