Preferred Name | (-)-beta-pinene | |
Synonyms |
(-)-nopinene (1S,5S)-beta-pinene (-)-pin-2(10)-ene (1S,5S)-6,6-Dimethyl-2-methylenebicyclo[3.1.1]heptane (1S,5S)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane (1S,5S)-pin-2(10)-ene (-)-beta-Pinene |
|
Definitions |
The (1S,5S)-enantiomer of beta-pinene. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28359 |
|
charge |
0 |
|
database_cross_reference |
KEGG:C06307 HMDB:HMDB0036559 CAS:18172-67-3 LIPID_MAPS_instance:LMPR0102120013 Reaxys:2038282 KNApSAcK:C00000806 |
|
definition |
The (1S,5S)-enantiomer of beta-pinene. |
|
formula |
C10H16 |
|
has_alternative_id |
CHEBI:18476 CHEBI:130 |
|
has_exact_synonym |
(1S,5S)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane (1S,5S)-pin-2(10)-ene (-)-beta-Pinene |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(-)-nopinene (1S,5S)-beta-pinene (-)-pin-2(10)-ene (1S,5S)-6,6-Dimethyl-2-methylenebicyclo[3.1.1]heptane |
|
id |
CHEBI:28359 |
|
in_subset | ||
inchi |
InChI=1S/C10H16/c1-7-4-5-8-6-9(7)10(8,2)3/h8-9H,1,4-6H2,2-3H3/t8-,9-/m0/s1 |
|
inchikey |
WTARULDDTDQWMU-IUCAKERBSA-N |
|
is enantiomer of | ||
label |
(-)-beta-pinene |
|
mass |
136.23404 |
|
monoisotopicmass |
136.12520 |
|
notation |
CHEBI:28359 |
|
prefLabel |
(-)-beta-pinene |
|
smiles |
CC1(C)[C@H]2CCC(=C)[C@@H]1C2 |
|
treeView | ||
subClassOf |