Preferred Name |
(2,4,5-trichlorophenoxy)acetic acid |
|
Synonyms |
(2,4,5-trichlorophenoxy)acetic acid 2,4,5-T (2,4,5-Trichlorphenoxy)essigsaeure Trioxone 2,4,5-Trichlorphenoxyessigsaeure Esteron 245 2,4,5-Trichlorophenoxyacetic acid |
|
Definitions |
A chlorophenoxyacetic acid that is phenoxyacetic acid in which the ring hydrogens at postions 2, 4 and 5 are substituted by chlorines. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27903 |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-24946 PMID:23085749 Gmelin:434052 PMID:23167922 Wikipedia:2,4,5-Trichlorophenoxyacetic_acid KEGG:C07100 Pesticides:2,4,5-t MetaCyc:CPD-10896 CAS:93-76-5 PPDB:1532 Beilstein:2055620 Reaxys:2055620 |
|
definition |
A chlorophenoxyacetic acid that is phenoxyacetic acid in which the ring hydrogens at postions 2, 4 and 5 are substituted by chlorines. |
|
formula |
C8H5Cl3O3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_23582 |
|
has_alternative_id |
CHEBI:897 |
|
has_exact_synonym |
(2,4,5-trichlorophenoxy)acetic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2,4,5-T (2,4,5-Trichlorphenoxy)essigsaeure Trioxone 2,4,5-Trichlorphenoxyessigsaeure Esteron 245 2,4,5-Trichlorophenoxyacetic acid |
|
id |
CHEBI:27903 |
|
in_subset | ||
inchi |
InChI=1S/C8H5Cl3O3/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13/h1-2H,3H2,(H,12,13) |
|
inchikey |
SMYMJHWAQXWPDB-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
(2,4,5-trichlorophenoxy)acetic acid |
|
mass |
255.48160 |
|
monoisotopicmass |
253.93043 |
|
notation |
CHEBI:27903 |
|
prefLabel |
(2,4,5-trichlorophenoxy)acetic acid |
|
smiles |
OC(=O)COc1cc(Cl)c(Cl)cc1Cl |
|
treeView | ||
subClassOf |