Preferred Name |
acetophenone |
|
Synonyms |
1-phenylethan-1-one Acetophenone acetophenone Methyl phenyl ketone Acetylbenzene benzoyl methide Phenyl methyl ketone 1-phenylethanone 1-Phenylethanone |
|
Definitions |
A methyl ketone that is acetone in which one of the methyl groups has been replaced by a phenyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27632 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Acetophenone PMID:24634568 HMDB:HMDB0033910 KNApSAcK:C00002685 DrugBank:DB04619 KEGG:C07113 CAS:98-86-2 PMID:10397882 UM-BBD_compID:c0117 |
|
definition |
A methyl ketone that is acetone in which one of the methyl groups has been replaced by a phenyl group. |
|
formula |
C8H8O |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_47868 |
|
has_alternative_id |
CHEBI:40490 CHEBI:22186 CHEBI:2403 |
|
has_exact_synonym |
1-phenylethan-1-one Acetophenone acetophenone |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Methyl phenyl ketone Acetylbenzene benzoyl methide Phenyl methyl ketone 1-phenylethanone 1-Phenylethanone |
|
id |
CHEBI:27632 |
|
in_subset | ||
inchi |
InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3 |
|
inchikey |
KWOLFJPFCHCOCG-UHFFFAOYSA-N |
|
label |
acetophenone |
|
mass |
120.14852 |
|
monoisotopicmass |
120.05751 |
|
notation |
CHEBI:27632 |
|
prefLabel |
acetophenone |
|
smiles |
CC(=O)c1ccccc1 |
|
treeView | ||
subClassOf |