Preferred Name | alprazolam | |
Synonyms |
8-Chloro-1-methyl-6-phenyl-4H-s-triazolo(4,3-a)(1,4)benzodiazepine Xanax Alprazolam 8-chloro-1-methyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|
Definitions |
A member of the class of triazolobenzodiazepines that is 4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine carrying methyl, phenyl and chloro substituents at positions 1, 6 and 8 respectively. Alprazolam is only found in individuals that have taken this drug. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_2611 |
|
charge |
0 |
|
database_cross_reference |
PMID:9050091 HMDB:HMDB0014548 PMID:25300043 PMID:24464531 PMID:25199955 PMID:25427652 PMID:25032127 PMID:25620535 PMID:15647704 KEGG:D00225 KEGG:C06817 PMID:17631455 PMID:24361783 PMID:24977401 PMID:11824768 Reaxys:1223125 PMID:10631626 PMID:12035937 PMID:16572266 PMID:10963939 PMID:25581490 PMID:24840273 PMID:10443648 DrugBank:DB00404 PMID:7907366 PMID:10997633 Wikipedia:Alprazolam VSDB:2960 PMID:24629629 PMID:15830221 LINCS:LSM-5460 Drug_Central:136 PMID:25139178 PMID:11304902 PMID:10350361 CAS:28981-97-7 PMID:16103667 PMID:15725773 PMID:16139113 |
|
definition |
A member of the class of triazolobenzodiazepines that is 4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine carrying methyl, phenyl and chloro substituents at positions 1, 6 and 8 respectively. Alprazolam is only found in individuals that have taken this drug. |
|
formula |
C17H13ClN4 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_51371 http://purl.obolibrary.org/obo/CHEBI_35474 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_35717 |
|
has_exact_synonym |
Alprazolam 8-chloro-1-methyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
8-Chloro-1-methyl-6-phenyl-4H-s-triazolo(4,3-a)(1,4)benzodiazepine Xanax |
|
id |
CHEBI:2611 |
|
in_subset | ||
inchi |
InChI=1S/C17H13ClN4/c1-11-20-21-16-10-19-17(12-5-3-2-4-6-12)14-9-13(18)7-8-15(14)22(11)16/h2-9H,10H2,1H3 |
|
inchikey |
VREFGVBLTWBCJP-UHFFFAOYSA-N |
|
label |
alprazolam |
|
mass |
308.76478 |
|
monoisotopicmass |
308.08287 |
|
notation |
CHEBI:2611 |
|
prefLabel |
alprazolam |
|
smiles |
Cc1nnc2CN=C(c3ccccc3)c3cc(Cl)ccc3-n12 |
|
treeView | ||
subClassOf |