loading...| Preferred Name | Epinephrine bitartrate | |
| Synonyms |
(2R,3R)-2,3-dihydroxybutanedioic acid;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
|
| Definitions |
Epinephrine Bitartrate is the bitartrate salt form of epinephrine, a direct-acting sympathomimetic amine with bronchodilator and vasoconstricting activity. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_228805 |
|
| charge |
0 |
|
| definition |
Epinephrine Bitartrate is the bitartrate salt form of epinephrine, a direct-acting sympathomimetic amine with bronchodilator and vasoconstricting activity. |
|
| formula |
C9H13NO3.C4H6O6 |
|
| has_exact_synonym |
(2R,3R)-2,3-dihydroxybutanedioic acid;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:228805 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H13NO3.C4H6O6/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;5-1(3(7)8)2(6)4(9)10/h2-4,9-13H,5H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t9-;1-,2-/m01/s1 |
|
| inchikey |
YLXIPWWIOISBDD-NDAAPVSOSA-N |
|
| label |
Epinephrine bitartrate |
|
| mass |
333.293 |
|
| monoisotopicmass |
333.10598 |
|
| notation |
CHEBI:228805 |
|
| prefLabel |
Epinephrine bitartrate |
|
| smiles |
O[C@H](C1=CC(O)=C(O)C=C1)CNC.O[C@H]([C@@H](O)C(O)=O)C(O)=O |
|
| treeView | ||
| subClassOf |