loading...| Preferred Name | methoxsalen | |
| Synonyms |
8-Methoxyfuranocoumarin Meloxine 8-methoxy-4',5':6,7-furocoumarin Xanthotoxin Ultra Mop 8-methoxy-2',3',6,7-furocoumarin 8-MP 6-hydroxy-7-methoxy-5-benzofuranacrylic acid delta-lactone 8-Methoxypsoralen O-Methylxanthotoxol 9-methoxy-7H-furo[3,2-g][1]benzopyran-7-one 8-methoxy-[furano-3'.2':6.7-coumarin] 8-methoxypsoralen Uvadex Meladinine O-methylxanthotoxol 8-MOP xanthotoxin Oxsoralen Methoxsalen 9-methoxy-7H-furo[3,2-g]chromen-7-one METHOXSALEN |
|
| Definitions |
A member of the class of psoralens that is 7H-furo[3,2-g]chromen-7-one in which the 9 position is substituted by a methoxy group. It is a constituent of the fruits of Ammi majus. Like other psoralens, trioxsalen causes photosensitization of the skin. It is administered topically or orally in conjunction with UV-A for phototherapy treatment of vitiligo and severe psoriasis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18358 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C01864 PMID:28166217 PMID:7945434 Drug_Central:30 KEGG:D00139 HMDB:HMDB0014693 Wikipedia:Methoxsalen Patent:US2889337 PDBeChem:8MO DrugBank:DB00553 PMID:15009205 Reaxys:196453 CAS:298-81-7 LINCS:LSM-3410 KNApSAcK:C00000576 |
|
| definition |
A member of the class of psoralens that is 7H-furo[3,2-g]chromen-7-one in which the 9 position is substituted by a methoxy group. It is a constituent of the fruits of Ammi majus. Like other psoralens, trioxsalen causes photosensitization of the skin. It is administered topically or orally in conjunction with UV-A for phototherapy treatment of vitiligo and severe psoriasis. |
|
| formula |
C12H8O4 |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_47868 http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_76924 |
|
| has_alternative_id |
CHEBI:27331 CHEBI:21960 CHEBI:12268 CHEBI:101063 CHEBI:27330 CHEBI:12715 CHEBI:10068 CHEBI:40342 |
|
| has_exact_synonym |
Methoxsalen 9-methoxy-7H-furo[3,2-g]chromen-7-one METHOXSALEN |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
8-Methoxyfuranocoumarin Meloxine 8-methoxy-4',5':6,7-furocoumarin Xanthotoxin Ultra Mop 8-methoxy-2',3',6,7-furocoumarin 8-MP 6-hydroxy-7-methoxy-5-benzofuranacrylic acid delta-lactone 8-Methoxypsoralen O-Methylxanthotoxol 9-methoxy-7H-furo[3,2-g][1]benzopyran-7-one 8-methoxy-[furano-3'.2':6.7-coumarin] 8-methoxypsoralen Uvadex Meladinine O-methylxanthotoxol 8-MOP xanthotoxin Oxsoralen |
|
| id |
CHEBI:18358 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H8O4/c1-14-12-10-8(4-5-15-10)6-7-2-3-9(13)16-11(7)12/h2-6H,1H3 |
|
| inchikey |
QXKHYNVANLEOEG-UHFFFAOYSA-N |
|
| label |
methoxsalen |
|
| mass |
216.18950 |
|
| monoisotopicmass |
216.04226 |
|
| notation |
CHEBI:18358 |
|
| prefLabel |
methoxsalen |
|
| smiles |
COc1c2occc2cc2ccc(=O)oc12 |
|
| treeView | ||
| subClassOf |