loading...| Preferred Name |
homocystine |
|
| Synonyms |
4,4'-disulfanediylbis(2-aminobutanoic acid) Homocystine 4,4'-Dithiobis(2-aminobutyric acid) 4,4'-dithiobis(2-aminobutyric acid) |
|
| Definitions |
An organic disulfide obtained by oxidative dimerisation of homocysteine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17485 |
|
| charge |
0 |
|
| database_cross_reference |
HMDB:HMDB0000575 KEGG:C01817 Reaxys:1728581 CAS:462-10-2 PMID:11896744 PMID:11592966 |
|
| definition |
An organic disulfide obtained by oxidative dimerisation of homocysteine. |
|
| formula |
C8H16N2O4S2 |
|
| has role | ||
| has_alternative_id |
CHEBI:24611 CHEBI:5752 CHEBI:14409 |
|
| has_exact_synonym |
4,4'-disulfanediylbis(2-aminobutanoic acid) Homocystine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
4,4'-Dithiobis(2-aminobutyric acid) 4,4'-dithiobis(2-aminobutyric acid) |
|
| id |
CHEBI:17485 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H16N2O4S2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14) |
|
| inchikey |
ZTVZLYBCZNMWCF-UHFFFAOYSA-N |
|
| is tautomer of | ||
| label |
homocystine |
|
| mass |
268.356 |
|
| monoisotopicmass |
268.05515 |
|
| notation |
CHEBI:17485 |
|
| prefLabel |
homocystine |
|
| smiles |
C(C(CCSSCCC(C(=O)O)N)N)(O)=O |
|
| treeView | ||
| subClassOf |