Preferred Name | phytol | |
Synonyms |
trans-Phytol (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-ol phytol (2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-ol Phytol |
|
Definitions |
A diterpenoid that is hexadec-2-en-1-ol substituted by methyl groups at positions 3, 7, 11 and 15. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17327 |
|
charge |
0 |
|
database_cross_reference |
PMID:17015885 PMID:24333358 Reaxys:7855349 HMDB:HMDB0002019 KEGG:C01389 CAS:7541-49-3 CAS:150-86-7 MetaCyc:PHYTOL PMID:24422895 PMID:24392173 KNApSAcK:C00003467 LIPID_MAPS_instance:LMPR0104010002 |
|
definition |
A diterpenoid that is hexadec-2-en-1-ol substituted by methyl groups at positions 3, 7, 11 and 15. |
|
formula |
C20H40O |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
has_alternative_id |
CHEBI:14836 CHEBI:26121 CHEBI:8193 |
|
has_exact_synonym |
phytol (2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-ol Phytol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
trans-Phytol (2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecen-1-ol |
|
id |
CHEBI:17327 |
|
in_subset | ||
inchi |
InChI=1S/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3/b20-15+/t18-,19-/m1/s1 |
|
inchikey |
BOTWFXYSPFMFNR-PYDDKJGSSA-N |
|
label |
phytol |
|
mass |
296.53100 |
|
monoisotopicmass |
296.30792 |
|
notation |
CHEBI:17327 |
|
prefLabel |
phytol |
|
smiles |
CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC\C(C)=C\CO |
|
treeView | ||
subClassOf |