loading...| Preferred Name | phloretin | |
| Synonyms |
3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-1-propanone phloretin Phloretin 3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one |
|
| Definitions |
A member of the class of dihydrochalcones that is dihydrochalcone substituted by hydroxy groups at positions 4, 2', 4' and 6'. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17276 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:18767070 PMID:7126563 CAS:60-82-2 PMID:23907072 Patent:CN102701938 MetaCyc:PHLORETIN DrugBank:DB07810 KNApSAcK:C00007936 LINCS:LSM-6221 Patent:CN103230408 HMDB:HMDB0003306 PDBeChem:G50 PMID:24487097 LIPID_MAPS_instance:LMPK12120525 KEGG:C00774 Wikipedia:Phloretin Reaxys:1887240 |
|
| definition |
A member of the class of dihydrochalcones that is dihydrochalcone substituted by hydroxy groups at positions 4, 2', 4' and 6'. |
|
| formula |
C15H14O5 |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:42649 CHEBI:26014 CHEBI:14787 CHEBI:8111 |
|
| has_exact_synonym |
phloretin Phloretin 3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-1-propanone |
|
| id |
CHEBI:17276 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H14O5/c16-10-4-1-9(2-5-10)3-6-12(18)15-13(19)7-11(17)8-14(15)20/h1-2,4-5,7-8,16-17,19-20H,3,6H2 |
|
| inchikey |
VGEREEWJJVICBM-UHFFFAOYSA-N |
|
| label |
phloretin |
|
| mass |
274.26866 |
|
| monoisotopicmass |
274.08412 |
|
| notation |
CHEBI:17276 |
|
| prefLabel |
phloretin |
|
| smiles |
Oc1ccc(CCC(=O)c2c(O)cc(O)cc2O)cc1 |
|
| treeView | ||
| subClassOf |