loading...| Preferred Name |
2-hydroxyethyl octadecanoate |
|
| Synonyms |
2-hydroxyethyl octadecanoate Lipo EGMS 2-hydroxyethyl stearate Clindrol SEG Monthyle glycol stearate Empilan 2848 USAF KE-11 S 151 stearic acid, monoester with ethylene glycol octadecanoic acid, 2-hydroxyethyl ester glycol monostearate ethylene glycol stearate Sedetol octadecanoic acid 2-hydroxyethyl ester Monthybase Prodhybase ethyl Prodhybas N Ivorit Parastarin ethylene glycol monostearate Emerest 2350 |
|
| Definitions |
An octadecanoate ester obtained by formal condensation between the carboxy group of octadecanoic (stearic) acid and one of the hydroxy groups of ethylene glycol. It is an ingredient in many personal care products and cosmetics. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_167626 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:111-60-4 Wikipedia:Glycol_stearate Reaxys:1794033 PMID:32499766 PMID:32353654 Chemspider:23148 |
|
| definition |
An octadecanoate ester obtained by formal condensation between the carboxy group of octadecanoic (stearic) acid and one of the hydroxy groups of ethylene glycol. It is an ingredient in many personal care products and cosmetics. |
|
| formula |
C20H40O3 |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_79056 |
|
| has_exact_synonym |
2-hydroxyethyl octadecanoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Lipo EGMS 2-hydroxyethyl stearate Clindrol SEG Monthyle glycol stearate Empilan 2848 USAF KE-11 S 151 stearic acid, monoester with ethylene glycol octadecanoic acid, 2-hydroxyethyl ester glycol monostearate ethylene glycol stearate Sedetol octadecanoic acid 2-hydroxyethyl ester Monthybase Prodhybase ethyl Prodhybas N Ivorit Parastarin ethylene glycol monostearate Emerest 2350 |
|
| id |
CHEBI:167626 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)23-19-18-21/h21H,2-19H2,1H3 |
|
| inchikey |
RFVNOJDQRGSOEL-UHFFFAOYSA-N |
|
| label |
2-hydroxyethyl octadecanoate |
|
| mass |
328.537 |
|
| monoisotopicmass |
328.29775 |
|
| notation |
CHEBI:167626 |
|
| prefLabel |
2-hydroxyethyl octadecanoate |
|
| smiles |
CCCCCCCCCCCCCCCCCC(=O)OCCO |
|
| treeView | ||
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_167626 | PDRO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_167626 | BERO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_167626 | DRON | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_167626 | PDRO | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_167626 | BERO | LOOM |