loading...| Preferred Name |
carnosine |
|
| Synonyms |
ignotine L-carnosine N-2-M N-(3-aminopropanoyl)-L-histidine Karnozzn Karnozin (2S)-2-(3-aminopropanamido)-3-(1H-imidazol-4-yl)propanoic acid Nalpha-(beta-alanyl)-L-histidine beta-alanyl-L-histidine N-beta-alanyl-L-histidine Carnosine N(alpha)-(beta-alanyl)-L-histidine |
|
| Definitions |
A dipeptide that is the N-(beta-alanyl) derivative of L-histidine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15727 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:20017611 PMID:15941308 HMDB:HMDB0000033 PMID:16287364 PMID:17443912 PMID:9928418 PMID:16162015 PMID:16804013 CAS:305-84-0 PMID:8689392 Wikipedia:Carnosine PMID:12139778 PMID:31951767 PMID:33704575 PMID:24398899 PMID:11911459 PMID:1735411 PMID:10951105 Reaxys:87671 PMID:34067694 PMID:2674258 PMID:19309105 PMID:29463897 PMID:16181134 PMID:9029640 KNApSAcK:C00052222 PMID:11470131 PMID:18076890 DrugBank:DB11695 PMID:20681748 PMID:15853927 PMID:17031479 PMID:18773880 PMID:16406688 PMID:18019400 PDBeChem:8V0 PMID:11976203 PMID:10841274 PMID:15878720 PMID:33586561 PMID:11707898 KEGG:C00386 PMID:10951108 Chemspider:388363 |
|
| definition |
A dipeptide that is the N-(beta-alanyl) derivative of L-histidine. |
|
| formula |
C9H14N4O3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_83056 http://purl.obolibrary.org/obo/CHEBI_22586 http://purl.obolibrary.org/obo/CHEBI_176497 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 |
|
| has_alternative_id |
CHEBI:3428 CHEBI:13948 CHEBI:23040 |
|
| has_exact_synonym |
Carnosine N(alpha)-(beta-alanyl)-L-histidine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
ignotine L-carnosine N-2-M N-(3-aminopropanoyl)-L-histidine Karnozzn Karnozin (2S)-2-(3-aminopropanamido)-3-(1H-imidazol-4-yl)propanoic acid Nalpha-(beta-alanyl)-L-histidine beta-alanyl-L-histidine N-beta-alanyl-L-histidine |
|
| id |
CHEBI:15727 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)/t7-/m0/s1 |
|
| inchikey |
CQOVPNPJLQNMDC-ZETCQYMHSA-N |
|
| is conjugate acid of | ||
| is tautomer of | ||
| label |
carnosine |
|
| mass |
226.236 |
|
| monoisotopicmass |
226.10659 |
|
| notation |
CHEBI:15727 |
|
| prefLabel |
carnosine |
|
| smiles |
NCCC(=O)N[C@@H](CC1=CNC=N1)C(O)=O |
|
| treeView | ||
| subClassOf |