Jump to:
loading...| Preferred Name |
lactobionate |
|
| Synonyms |
lactobionate 4-O-beta-D-galactopyranosyl-D-gluconate |
|
| Definitions |
A gluconate that is the conjugate base of lactobionic acid arising from the deprotonation of the carboxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_143069 |
|
| charge |
-1 |
|
| database_cross_reference |
PMID:11179980 |
|
| definition |
A gluconate that is the conjugate base of lactobionic acid arising from the deprotonation of the carboxy group. |
|
| formula |
C12H21O12 |
|
| has_exact_synonym |
lactobionate 4-O-beta-D-galactopyranosyl-D-gluconate |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:143069 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H22O12/c13-1-3(15)10(7(18)8(19)11(21)22)24-12-9(20)6(17)5(16)4(2-14)23-12/h3-10,12-20H,1-2H2,(H,21,22)/p-1/t3-,4-,5+,6+,7-,8-,9-,10-,12+/m1/s1 |
|
| inchikey |
JYTUSYBCFIZPBE-AMTLMPIISA-M |
|
| is conjugate base of | ||
| label |
lactobionate |
|
| mass |
357.289 |
|
| monoisotopicmass |
357.10385 |
|
| notation |
CHEBI:143069 |
|
| prefLabel |
lactobionate |
|
| smiles |
O[C@@H]([C@H]([C@@H]([C@H](C([O-])=O)O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O)CO |
|
| treeView | ||
| subClassOf |
Create mapping
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_143069 | BERO | SAME_URI | |
| http://sbmi.uth.tmc.edu/ontology/ochv#C0206824 | OCHV | LOOM | |
| http://sbmi.uth.tmc.edu/ontology/ochv#21071 | OCHV | LOOM | |
| http://purl.bioontology.org/ontology/RXNORM/1426414 | RXNORM | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_143069 | BERO | LOOM |