loading...| Preferred Name | crisaborole | |
| Synonyms |
AN 2728 AN2728 Crisaborole topical ointment 2% crisaborole AN-2728 Eucrisa 4-[(1-hydroxy-1,3-dihydro-2,1-benzoxaborol-5-yl)oxy]benzonitrile |
|
| Definitions |
A member of the class of benzoxaboroles that is 5-hydroxy-1,3-dihydro-2,1-benzoxaborole in which the phenolic hydrogen has been replaced by a 4-cyanophenyl group. A phosphodiesterase 4 inhibitor that is used for treatment of mild to moderate atopic dermatitis in children and adults. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_134677 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:27525671 PMID:24852768 PMID:20094643 PMID:23625818 PMID:27193740 PMID:27335049 PMID:26885784 PMID:27417017 PMID:26461821 PMID:28163553 PMID:27928191 KEGG:D10873 PMID:26659931 PMID:27353073 Reaxys:11622826 PMID:27283509 CAS:906673-24-3 PMID:19876791 PMID:26777394 PMID:27050693 PMID:19303290 PMID:20383346 |
|
| definition |
A member of the class of benzoxaboroles that is 5-hydroxy-1,3-dihydro-2,1-benzoxaborole in which the phenolic hydrogen has been replaced by a 4-cyanophenyl group. A phosphodiesterase 4 inhibitor that is used for treatment of mild to moderate atopic dermatitis in children and adults. |
|
| formula |
C14H10BNO3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_68844 |
|
| has_exact_synonym |
4-[(1-hydroxy-1,3-dihydro-2,1-benzoxaborol-5-yl)oxy]benzonitrile |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
AN 2728 AN2728 Crisaborole topical ointment 2% crisaborole AN-2728 Eucrisa |
|
| id |
CHEBI:134677 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H10BNO3/c16-8-10-1-3-12(4-2-10)19-13-5-6-14-11(7-13)9-18-15(14)17/h1-7,17H,9H2 |
|
| inchikey |
USZAGAREISWJDP-UHFFFAOYSA-N |
|
| label |
crisaborole |
|
| mass |
251.046 |
|
| monoisotopicmass |
251.07537 |
|
| notation |
CHEBI:134677 |
|
| prefLabel |
crisaborole |
|
| smiles |
C1=C(C=C2C(=C1)B(OC2)O)OC3=CC=C(C=C3)C#N |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_35618 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |