loading...| Preferred Name | 3,3',5'-triiodo-L-thyronine | |
| Synonyms |
L-3,3',5'-triiodothyronine reverse L-triiodothyronine Reverse triiodothyronine 4-(4-hydroxy-3,5-diiodophenoxy)-3-iodo-L-phenylalanine rT3 O-(4-hydroxy-3,5-diiodophenyl)-3-iodo-L-tyrosine 3,3',5'-triiodo-L-thyronine |
|
| Definitions |
The L-enantiomer of 3,3',5'-triiodothyronine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_11684 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:34569083 PMID:30366665 CAS:5817-39-0 KEGG:C07639 PMID:38149630 PMID:34714056 Beilstein:2823535 PMID:34916749 |
|
| definition |
The L-enantiomer of 3,3',5'-triiodothyronine. |
|
| formula |
C15H12I3NO4 |
|
| has_exact_synonym |
3,3',5'-triiodo-L-thyronine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
L-3,3',5'-triiodothyronine reverse L-triiodothyronine Reverse triiodothyronine 4-(4-hydroxy-3,5-diiodophenoxy)-3-iodo-L-phenylalanine rT3 O-(4-hydroxy-3,5-diiodophenyl)-3-iodo-L-tyrosine |
|
| id |
CHEBI:11684 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H12I3NO4/c16-9-3-7(4-12(19)15(21)22)1-2-13(9)23-8-5-10(17)14(20)11(18)6-8/h1-3,5-6,12,20H,4,19H2,(H,21,22)/t12-/m0/s1 |
|
| inchikey |
HZCBWYNLGPIQRK-LBPRGKRZSA-N |
|
| is enantiomer of | ||
| is tautomer of | ||
| label |
3,3',5'-triiodo-L-thyronine |
|
| mass |
650.97353 |
|
| monoisotopicmass |
650.79004 |
|
| notation |
CHEBI:11684 |
|
| prefLabel |
3,3',5'-triiodo-L-thyronine |
|
| smiles |
N[C@@H](Cc1ccc(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(O)=O |
|
| treeView | ||
| subClassOf |