loading...| Preferred Name |
diclofenamide |
|
| Synonyms |
Diclofenamide DICLOFENAMIDE 4,5-dichlorobenzene-1,3-disulfonamide diclofenamidum dichlorophenamide Dichlorophenamide DICHLORPHENAMIDE 1,3-disulfamoyl-4,5-dichlorobenzene dichlorphenamide 4,5-dichloro-m-benzenedisulfonamide 1,3-disulfamyl-4,5-dichlorobenzene 4,5-DICHLOROBENZENE-1,3-DISULFONAMIDE diclofenamida Dichlorphenamide dichlofenamide 4,5-dichloro-1,3-benzenedisulfonamide 3,4-dichloro-5-sulfamylbenzenesulfonamide 4,5-dichloro-benzene-1,3-disulfonic acid diamide 4,5-dichloro-1,3-disulfamoylbenzene |
|
| Definitions |
A sulfonamide that is benzene-1,3-disulfonamide in which the hydrogens at positions 4 and 5 are substituted by chlorine. An oral carbonic anhydrase inhibitor, it partially suppresses the secretion (inflow) of aqueous humor in the eye and so reduces intraocular pressure. It is used for the treatment of glaucoma. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_101085 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D00518 CAS:120-97-8 KEGG:C07459 DrugBank:DB01144 Patent:US2835702 PDBeChem:I7A LINCS:LSM-3602 Beilstein:2703329 Drug_Central:864 Wikipedia:Dichlorphenamide |
|
| definition |
A sulfonamide that is benzene-1,3-disulfonamide in which the hydrogens at positions 4 and 5 are substituted by chlorine. An oral carbonic anhydrase inhibitor, it partially suppresses the secretion (inflow) of aqueous humor in the eye and so reduces intraocular pressure. It is used for the treatment of glaucoma. |
|
| formula |
C6H6Cl2N2O4S2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_39456 |
|
| has_alternative_id |
CHEBI:4505 CHEBI:47477 |
|
| has_exact_synonym |
Diclofenamide DICLOFENAMIDE 4,5-dichlorobenzene-1,3-disulfonamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
diclofenamidum dichlorophenamide Dichlorophenamide DICHLORPHENAMIDE 1,3-disulfamoyl-4,5-dichlorobenzene dichlorphenamide 4,5-dichloro-m-benzenedisulfonamide 1,3-disulfamyl-4,5-dichlorobenzene 4,5-DICHLOROBENZENE-1,3-DISULFONAMIDE diclofenamida Dichlorphenamide dichlofenamide 4,5-dichloro-1,3-benzenedisulfonamide 3,4-dichloro-5-sulfamylbenzenesulfonamide 4,5-dichloro-benzene-1,3-disulfonic acid diamide 4,5-dichloro-1,3-disulfamoylbenzene |
|
| id |
CHEBI:101085 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H6Cl2N2O4S2/c7-4-1-3(15(9,11)12)2-5(6(4)8)16(10,13)14/h1-2H,(H2,9,11,12)(H2,10,13,14) |
|
| inchikey |
GJQPMPFPNINLKP-UHFFFAOYSA-N |
|
| label |
diclofenamide |
|
| mass |
305.15900 |
|
| monoisotopicmass |
303.91460 |
|
| notation |
CHEBI:101085 |
|
| prefLabel |
diclofenamide |
|
| smiles |
NS(=O)(=O)c1cc(Cl)c(Cl)c(c1)S(N)(=O)=O |
|
| treeView | ||
| subClassOf |