Preferred Name |
lactulose |
|
Synonyms |
D-Lactulose 4-O-beta-D-Galactopyranosyl-D-fructose 4-O-beta-D-Galactopyranosyl-D-fructofuranose lactulosa lactulose lactulosum 4-O-beta-D-galactopyranosyl-beta-D-fructofuranose Lactulose |
|
Definitions |
A synthetic galactosylfructose disaccharide used in the treatment of constipation and hepatic encephalopathy. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6359 |
|
charge |
0 |
|
definition |
A synthetic galactosylfructose disaccharide used in the treatment of constipation and hepatic encephalopathy. |
|
formula |
C12H22O11 |
|
hasAlternativeId |
CHEBI:302765 |
|
hasDbXref |
CAS:4618-18-2 PMID:25300228 PMID:25586470 PMID:25700936 KEGG:G03573 PMID:25800379 HMDB:HMDB0000740 PMID:11020286 PMID:25916046 Beilstein:93773 PMID:15735433 PMID:25466139 PMID:25835949 Wikipedia:Lactulose DrugBank:DB00581 KEGG:C07064 PMID:2432147 PMID:23353997 PMID:12927899 KEGG:D00352 PMID:25935392 |
|
hasExactSynonym |
4-O-beta-D-galactopyranosyl-beta-D-fructofuranose Lactulose |
|
hasOBONamespace |
chebi_ontology |
|
hasRelatedSynonym |
D-Lactulose 4-O-beta-D-Galactopyranosyl-D-fructose 4-O-beta-D-Galactopyranosyl-D-fructofuranose lactulosa lactulose lactulosum |
|
id |
CHEBI:6359 |
|
inchi |
InChI=1S/C12H22O11/c13-1-4-6(16)7(17)8(18)11(21-4)22-9-5(2-14)23-12(20,3-15)10(9)19/h4-11,13-20H,1-3H2/t4-,5-,6+,7+,8-,9-,10+,11+,12-/m1/s1 |
|
inchikey |
JCQLYHFGKNRPGE-FCVZTGTOSA-N |
|
inSubset | ||
label |
lactulose lactulose |
|
mass |
342.29650 |
|
monoisotopicmass |
342.11621 |
|
notation |
CHEBI:6359 |
|
prefLabel |
lactulose |
|
smiles |
OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@](O)(CO)[C@H]2O)[C@H](O)[C@@H](O)[C@H]1O |
|
subClassOf |