loading...| Preferred Name |
flavone |
|
| Synonyms |
2-phenyl-4H-chromen-4-one Flavone flavone 2-phenyl-4H-1-benzopyran-4-one 2-phenyl-4H-benzopyran-4-one 2-phenylchromone 2-PHENYL-4H-CHROMEN-4-ONE 2-Phenyl-4-chromone 2-Phenylbenzopyran-4-one 2-phenyl-gamma-benzopyrone 2-Phenyl-4-benzopyron Flavon |
|
| Definitions |
The simplest member of the class of flavones that consists of 4H-chromen-4-one bearing a phenyl substituent at position 2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_42491 |
|
| charge |
0 |
|
| definition |
The simplest member of the class of flavones that consists of 4H-chromen-4-one bearing a phenyl substituent at position 2. |
|
| formula |
C15H10O2 |
|
| hasAlternativeId |
CHEBI:42486 CHEBI:5076 |
|
| hasDbXref |
KNApSAcK:C00001040 DrugBank:DB07776 PMID:12063116 PMID:11370674 MetaCyc:CPD-8485 CAS:525-82-6 PMID:17347140 Beilstein:157598 PDBeChem:FLN KEGG:C10043 PMID:18596412 HMDB:HMDB0003075 KEGG:C15608 LIPID_MAPS_instance:LMPK12110097 Reaxys:157598 Gmelin:1224858 |
|
| hasExactSynonym |
2-phenyl-4H-chromen-4-one Flavone flavone |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
2-phenyl-4H-1-benzopyran-4-one 2-phenyl-4H-benzopyran-4-one 2-phenylchromone 2-PHENYL-4H-CHROMEN-4-ONE 2-Phenyl-4-chromone 2-Phenylbenzopyran-4-one 2-phenyl-gamma-benzopyrone 2-Phenyl-4-benzopyron Flavon |
|
| id |
CHEBI:42491 |
|
| inchi |
InChI=1S/C15H10O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H |
|
| inchikey |
VHBFFQKBGNRLFZ-UHFFFAOYSA-N |
|
| inSubset | ||
| label |
flavone flavone |
|
| mass |
222.23870 |
|
| monoisotopicmass |
222.06808 |
|
| notation |
CHEBI:42491 |
|
| prefLabel |
flavone |
|
| smiles |
O=c1cc(oc2ccccc12)-c1ccccc1 |
|
| subClassOf |