loading...| Preferred Name |
acetophenone |
|
| Synonyms |
Acetophenone 1-phenylethan-1-one acetophenone 1-phenylethanone Phenyl methyl ketone 1-Phenylethanone Acetylbenzene benzoyl methide Methyl phenyl ketone |
|
| Definitions |
A methyl ketone that is acetone in which one of the methyl groups has been replaced by a phenyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27632 |
|
| charge |
0 |
|
| definition |
A methyl ketone that is acetone in which one of the methyl groups has been replaced by a phenyl group. |
|
| formula |
C8H8O |
|
| hasAlternativeId |
CHEBI:40490 CHEBI:22186 CHEBI:2403 |
|
| hasDbXref |
KNApSAcK:C00002685 Wikipedia:Acetophenone KEGG:C07113 UM-BBD_compID:c0117 PMID:10397882 PMID:24634568 HMDB:HMDB0033910 DrugBank:DB04619 CAS:98-86-2 |
|
| hasExactSynonym |
Acetophenone 1-phenylethan-1-one acetophenone |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
1-phenylethanone Phenyl methyl ketone 1-Phenylethanone Acetylbenzene benzoyl methide Methyl phenyl ketone |
|
| id |
CHEBI:27632 |
|
| inchi |
InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3 |
|
| inchikey |
KWOLFJPFCHCOCG-UHFFFAOYSA-N |
|
| inSubset | ||
| label |
acetophenone acetophenone |
|
| mass |
120.14852 |
|
| monoisotopicmass |
120.05751 |
|
| notation |
CHEBI:27632 |
|
| prefLabel |
acetophenone |
|
| smiles |
CC(=O)c1ccccc1 |
|
| subClassOf |