Preferred Name |
acetophenone |
|
Synonyms |
Acetophenone 1-phenylethan-1-one acetophenone 1-phenylethanone Phenyl methyl ketone 1-Phenylethanone Acetylbenzene benzoyl methide Methyl phenyl ketone |
|
Definitions |
A methyl ketone that is acetone in which one of the methyl groups has been replaced by a phenyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27632 |
|
charge |
0 |
|
definition |
A methyl ketone that is acetone in which one of the methyl groups has been replaced by a phenyl group. |
|
formula |
C8H8O |
|
hasAlternativeId |
CHEBI:40490 CHEBI:22186 CHEBI:2403 |
|
hasDbXref |
KNApSAcK:C00002685 Wikipedia:Acetophenone KEGG:C07113 UM-BBD_compID:c0117 PMID:10397882 PMID:24634568 HMDB:HMDB0033910 DrugBank:DB04619 CAS:98-86-2 |
|
hasExactSynonym |
Acetophenone 1-phenylethan-1-one acetophenone |
|
hasOBONamespace |
chebi_ontology |
|
hasRelatedSynonym |
1-phenylethanone Phenyl methyl ketone 1-Phenylethanone Acetylbenzene benzoyl methide Methyl phenyl ketone |
|
id |
CHEBI:27632 |
|
inchi |
InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3 |
|
inchikey |
KWOLFJPFCHCOCG-UHFFFAOYSA-N |
|
inSubset | ||
label |
acetophenone acetophenone |
|
mass |
120.14852 |
|
monoisotopicmass |
120.05751 |
|
notation |
CHEBI:27632 |
|
prefLabel |
acetophenone |
|
smiles |
CC(=O)c1ccccc1 |
|
subClassOf |