Preferred Name |
catechol |
|
Synonyms |
1,2-Benzenediol alpha-hydroxyphenol o-hydroxyphenol pyrocatechin 2-hydroxyphenol 1,2-Dihydroxybenzene Brenzcatechin Pyrocatechol o-Benzenediol benzene-1,2-diol Catechol catechol |
|
Definitions |
A benzenediol comprising of a benzene core carrying two hydroxy substituents ortho to each other. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_18135 |
|
charge |
0 |
|
definition |
A benzenediol comprising of a benzene core carrying two hydroxy substituents ortho to each other. |
|
formula |
C6H6O2 |
|
hasAlternativeId |
CHEBI:41441 CHEBI:13950 CHEBI:135158 CHEBI:23054 CHEBI:3467 |
|
hasDbXref |
MetaCyc:CATECHOL PDBeChem:CAQ PMID:10651166 KNApSAcK:C00002644 Gmelin:2936 Beilstein:471401 CAS:120-80-9 HMDB:HMDB0000957 UM-BBD_compID:c0097 KEGG:C15571 Reaxys:471401 PMID:11470755 PMID:16610220 DrugBank:DB02232 Wikipedia:Catechol KEGG:C00090 KEGG:C01785 PMID:15951152 CAS:12385-08-9 |
|
hasExactSynonym |
benzene-1,2-diol Catechol catechol |
|
hasOBONamespace |
chebi_ontology |
|
hasRelatedSynonym |
1,2-Benzenediol alpha-hydroxyphenol o-hydroxyphenol pyrocatechin 2-hydroxyphenol 1,2-Dihydroxybenzene Brenzcatechin Pyrocatechol o-Benzenediol |
|
id |
CHEBI:18135 |
|
inchi |
InChI=1S/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
|
inchikey |
YCIMNLLNPGFGHC-UHFFFAOYSA-N |
|
inSubset | ||
label |
catechol catechol |
|
mass |
110.11064 |
|
monoisotopicmass |
110.03678 |
|
notation |
CHEBI:18135 |
|
prefLabel |
catechol |
|
smiles |
Oc1ccccc1O |
|
subClassOf |