Preferred Name |
pyrogallol |
|
Synonyms |
benzene-1,2,3-triol Pyrogallol Pyrogallic acid 1,2,3-Trihydroxybenzene 1,2,3-Benzenetriol 1,2,3-trihydroxybenzene |
|
Definitions |
A benzenetriol carrying hydroxy groups at positions 1, 2 and 3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16164 |
|
charge |
0 |
|
definition |
A benzenetriol carrying hydroxy groups at positions 1, 2 and 3. |
|
formula |
C6H6O3 |
|
hasAlternativeId |
CHEBI:22708 CHEBI:45264 CHEBI:14985 CHEBI:11135 CHEBI:482 |
|
hasDbXref |
PMID:10427737 KNApSAcK:C00002670 UM-BBD_compID:c0025 HMDB:HMDB0013674 PMID:18760383 PMID:19948158 PMID:24415452 CAS:87-66-1 PMID:24458986 KEGG:C01108 Reaxys:907431 Wikipedia:Pyrogallol MetaCyc:PYROGALLOL PMID:18506365 |
|
hasExactSynonym |
benzene-1,2,3-triol Pyrogallol |
|
hasOBONamespace |
chebi_ontology |
|
hasRelatedSynonym |
Pyrogallic acid 1,2,3-Trihydroxybenzene 1,2,3-Benzenetriol 1,2,3-trihydroxybenzene benzene-1,2,3-triol |
|
id |
CHEBI:16164 |
|
inchi |
InChI=1S/C6H6O3/c7-4-2-1-3-5(8)6(4)9/h1-3,7-9H |
|
inchikey |
WQGWDDDVZFFDIG-UHFFFAOYSA-N |
|
inSubset | ||
label |
pyrogallol pyrogallol |
|
mass |
126.11004 |
|
monoisotopicmass |
126.03169 |
|
notation |
CHEBI:16164 |
|
prefLabel |
pyrogallol |
|
smiles |
Oc1cccc(O)c1O |
|
subClassOf |