Link to this page
Cell Culture Ontology
Last uploaded:
July 23, 2014
Jump to:
| Preferred Name | sodium butyrate | |
| Synonyms |
Butanoic acid, sodium salt Butanoic acid, sodium salt (1:1) Butyric acid sodium salt Butyric acid, sodium salt Sodium propanecarboxylate Butyrate sodium Sodium n-butyrate sodium butanoate |
|
| Definitions |
An organic sodium salt resulting from the replacement of the proton from the carboxy group of butyric acid by a sodium ion. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_64103 |
|
| charge |
0
|
|
| database_cross_reference |
CiteXplore:12840228 CiteXplore:22288569 PMID:22160140 CiteXplore:21593570 PMID:21947091 PMID:24003736 PMID:22353286 NIST Chemistry WebBook:156-54-7 KEGG:D08998 CiteXplore:21984169 PMID:22381755 PMID:22246241 PMID:21984169 ChemIDplus:156-54-7 PMID:22253909 PMID:22024383 PMID:22288569 PMID:22067609 PMID:21699495 CiteXplore:22067609 CiteXplore:22253909 CiteXplore:22353286 CiteXplore:21947091 PMID:22273669 CiteXplore:22381755 CiteXplore:22273669 CiteXplore:22024383 CiteXplore:22160140 PMID:22228088 CiteXplore:22338096 Wikipedia:Sodium_butyrate CAS:156-54-7 PMID:21593570 Reaxys:3629439 CiteXplore:21699495 PMID:12840228 DrugBank:DBSALT002877 PMID:22293191 PMID:22338096 CiteXplore:22293191 CiteXplore:22228088 ChEMBL:200479 CiteXplore:22246241 NCIt:C2337
|
|
| definition |
An organic sodium salt resulting from the replacement of the proton from the carboxy group of butyric acid by a sodium ion.
|
|
| formula |
C4H7NaO2
|
|
| has_exact_synonym |
sodium butanoate
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
Butanoic acid, sodium salt Butanoic acid, sodium salt (1:1) Butyric acid sodium salt Butyric acid, sodium salt Sodium propanecarboxylate Butyrate sodium Sodium n-butyrate
|
|
| id |
CHEBI:64103
|
|
| in_subset | ||
| inchi |
InChI=1S/C4H8O2.Na/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6);/q;+1/p-1
|
|
| inchikey |
MFBOGIVSZKQAPD-UHFFFAOYSA-M
|
|
| label |
sodium butyrate
|
|
| mass |
110.08690
|
|
| monoisotopicmass |
110.03437
|
|
| notation |
CHEBI:64103
|
|
| preferred label |
sodium butyrate
|
|
| prefLabel |
sodium butyrate
|
|
| smiles |
[Na+].CCCC([O-])=O
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping