Preferred Name |
fenofibrate |
|
Synonyms |
Antara Triglide Finofibrate Isopropyl 2-(4-(4-chlorobenzoyl)phenoxy)-2-methylpropionate 2-(4-(4-Chlorobenzoyl)phenoxy)-2-methylpropanoic acid 1-methylethyl ester Lipofen Isopropyl (4'-(p-chlorobenzoyl)-2-phenoxy-2-methyl)propionate FNF Procetofen Tricor Lipantil propan-2-yl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate Fenofibrate |
|
Definitions |
A chlorobenzophenone that is (4-chlorophenyl)(phenyl)methanone substituted by a [2-methyl-1-oxo-1-(propan-2-yloxy)propan-2-yl]oxy group at position 1 on the phenyl ring. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5001 |
|
bearer_of | ||
charge |
0 |
|
database_cross_reference |
KEGG DRUG:D00565 "KEGG DRUG" KEGG COMPOUND:49562-28-9 "CAS Registry Number" SNOMEDCT:386879008 ChemIDplus:49562-28-9 "CAS Registry Number" Patent:US4058552 "Patent" KEGG COMPOUND:C07586 "KEGG COMPOUND" Patent:DE2250327 "Patent" NCIt:C29047 MeSH:D011345 DrugBank:DB01039 "DrugBank" Wikipedia:Fenofibrate "Wikipedia" SNOMEDCT:108603001 PMID:18212815 Patent:US4058552 KEGG:C07586 DrugBank:DB01039 PMID:33704429 PMID:32675219 Chemspider:3222 PMID:23603800 Drug_Central:1152 Reaxys:2062462 HMDB:HMDB0015173 Wikipedia:Fenofibrate PMID:34515330 Patent:DE2250327 KEGG:D00565 PMID:34244236 CAS:49562-28-9 PMID:17449930 LINCS:LSM-3107 |
|
definition |
A chlorobenzophenone that is (4-chlorophenyl)(phenyl)methanone substituted by a [2-methyl-1-oxo-1-(propan-2-yloxy)propan-2-yl]oxy group at position 1 on the phenyl ring. |
|
formula |
C20H21ClO4 |
|
has_exact_synonym |
propan-2-yl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate Fenofibrate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Antara Triglide Finofibrate Isopropyl 2-(4-(4-chlorobenzoyl)phenoxy)-2-methylpropionate 2-(4-(4-Chlorobenzoyl)phenoxy)-2-methylpropanoic acid 1-methylethyl ester Lipofen Isopropyl (4'-(p-chlorobenzoyl)-2-phenoxy-2-methyl)propionate FNF Procetofen Tricor Lipantil |
|
has_role | ||
id |
CHEBI:5001 |
|
in_subset | ||
inchi |
InChI=1S/C20H21ClO4/c1-13(2)24-19(23)20(3,4)25-17-11-7-15(8-12-17)18(22)14-5-9-16(21)10-6-14/h5-13H,1-4H3 |
|
inchikey |
YMTINGFKWWXKFG-UHFFFAOYSA-N |
|
label |
fenofibrate |
|
mass |
360.83100 |
|
monoisotopicmass |
360.11284 |
|
notation |
CHEBI:5001 |
|
preferred label |
fenofibrate |
|
prefLabel |
fenofibrate |
|
smiles |
CC(C)OC(=O)C(C)(C)Oc1ccc(cc1)C(=O)c1ccc(Cl)cc1 |
|
subClassOf |