loading...| Preferred Name | isocitric acid | |
| Synonyms |
1-Hydroxytricarballylic acid 1-Hydroxypropane-1,2,3-tricarboxylic acid 1-hydroxypropane-1,2,3-tricarboxylic acid 3-carboxy-2,3-dideoxypentaric acid Isocitric acid |
|
| Definitions |
A tricarboxylic acid that is propan-1-ol with a hydrogen at each of the 3 carbon positions replaced by a carboxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30887 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Isocitric_acid PMID:24702026 PMID:23989918 KEGG:C00311 Reaxys:1727945 YMDB:YMDB00026 DrugBank:DB01727 CAS:320-77-4 ECMDB:ECMDB04088 PMID:17439666 MetaCyc:Isocitrate HMDB:HMDB0000193 Beilstein:1727945 KNApSAcK:C00001188 |
|
| definition |
A tricarboxylic acid that is propan-1-ol with a hydrogen at each of the 3 carbon positions replaced by a carboxy group. |
|
| formula |
C6H8O7 |
|
| has_alternative_id |
CHEBI:24886 CHEBI:5998 |
|
| has_exact_synonym |
1-hydroxypropane-1,2,3-tricarboxylic acid 3-carboxy-2,3-dideoxypentaric acid Isocitric acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1-Hydroxytricarballylic acid 1-Hydroxypropane-1,2,3-tricarboxylic acid |
|
| id |
CHEBI:30887 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13) |
|
| inchikey |
ODBLHEXUDAPZAU-UHFFFAOYSA-N |
|
| label |
isocitric acid |
|
| mass |
192.12352 |
|
| monoisotopicmass |
192.02700 |
|
| notation |
CHEBI:30887 |
|
| preferred label |
isocitric acid |
|
| prefLabel |
isocitric acid |
|
| smiles |
OC(C(CC(O)=O)C(O)=O)C(O)=O |
|
| subClassOf |