Preferred Name | calciol | |
Synonyms |
colecalciferol Cholecalciferol (1S,3Z)-3-[(2E)-2-[(1R,3AR,7AS)-7A-METHYL-1-[(2R)-6-METHYLHEPTAN-2-YL]-2,3,3A,5,6,7-HEXAHYDRO-1H-INDEN-4-YLIDENE]ETHYLIDENE]-4-METHYLIDENE-CYCLOHEXAN-1-OL activated 7-dehydrocholesterol (+)-vitamin D3 (5Z,7E)-(3S)-9,10-secocholesta-5,7,10(19)-trien-3-ol (3beta,5Z,7E)-9,10-secocholesta-5,7,10(19)-trien-3-ol oleovitamin D3 CC Delta-D Vitamin D3 vitamin D3 (3S,5Z,7E)-9,10-secocholesta-5,7,10(19)-trien-3-ol calciol |
|
Definitions |
A hydroxy seco-steroid that is (5Z,7E)-9,10-secocholesta-5,7,10(19)-triene in which the pro-S hydrogen at position 3 has been replaced by a hydroxy group. It is the inactive form of vitamin D3, being hydroxylated in the liver to calcidiol (25-hydroxyvitamin D3), which is then further hydroxylated in the kidney to give calcitriol (1,25-dihydroxyvitamin D3), the active hormone. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28940 |
|
charge |
0 |
|
database_cross_reference |
PMID:10347174 Gmelin:1267613 Drug_Central:2840 Reaxys:2339331 CAS:67-97-0 DrugBank:DB00169 PMID:11493580 PDBeChem:VD3 SNOMEDCT:18414002 PMID:17156784 PMID:15214747 Beilstein:2339331 PMID:12955389 PMID:2838261 KEGG:C05443 HMDB:HMDB0000876 PMID:16886665 PMID:3494111 NCIt:C48194 PMID:24304198 LIPID_MAPS_instance:LMST03020000 KEGG:D00188 LIPID_MAPS_instance:LMST03020001 PMID:184223 PMID:6265326 MeSH:D002762 PMID:9627702 PMID:15876428 PMID:19817701 PMID:12174089 Wikipedia:Cholecalciferol PMID:2997282 PMID:23964472 PPDB:160 |
|
definition |
A hydroxy seco-steroid that is (5Z,7E)-9,10-secocholesta-5,7,10(19)-triene in which the pro-S hydrogen at position 3 has been replaced by a hydroxy group. It is the inactive form of vitamin D3, being hydroxylated in the liver to calcidiol (25-hydroxyvitamin D3), which is then further hydroxylated in the kidney to give calcitriol (1,25-dihydroxyvitamin D3), the active hormone. |
|
formula |
C27H44O |
|
has characteristic | ||
has_alternative_id |
CHEBI:46283 CHEBI:10008 CHEBI:23170 |
|
has_exact_synonym |
(3S,5Z,7E)-9,10-secocholesta-5,7,10(19)-trien-3-ol calciol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
colecalciferol Cholecalciferol (1S,3Z)-3-[(2E)-2-[(1R,3AR,7AS)-7A-METHYL-1-[(2R)-6-METHYLHEPTAN-2-YL]-2,3,3A,5,6,7-HEXAHYDRO-1H-INDEN-4-YLIDENE]ETHYLIDENE]-4-METHYLIDENE-CYCLOHEXAN-1-OL activated 7-dehydrocholesterol (+)-vitamin D3 (5Z,7E)-(3S)-9,10-secocholesta-5,7,10(19)-trien-3-ol (3beta,5Z,7E)-9,10-secocholesta-5,7,10(19)-trien-3-ol oleovitamin D3 CC Delta-D Vitamin D3 vitamin D3 |
|
has_role | ||
id |
CHEBI:28940 |
|
in_subset | ||
inchi |
InChI=1S/C27H44O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h12-13,19,21,24-26,28H,3,6-11,14-18H2,1-2,4-5H3/b22-12+,23-13-/t21-,24+,25-,26+,27-/m1/s1 |
|
inchikey |
QYSXJUFSXHHAJI-YRZJJWOYSA-N |
|
label |
calciol |
|
mass |
384.63766 |
|
monoisotopicmass |
384.33922 |
|
notation |
CHEBI:28940 |
|
preferred label |
calciol |
|
prefLabel |
calciol |
|
smiles |
[H][C@@]1(CC[C@]2([H])[C@]1(C)CCC\C2=C/C=C1/C[C@@H](O)CCC1=C)[C@H](C)CCCC(C)C |
|
subClassOf |